![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | 7-Shanghai-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | 10-Changi-Airport-MRT-Station-Singapore.jpg | 2022-10-19 08:17 | 69K | |
![[IMG]](/icons/image2.gif) | 30347_zoom1-150x150.jpg | 2022-10-19 08:17 | 5.3K | |
![[IMG]](/icons/image2.gif) | 6315475938_8b7afbf5f6_z-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | Bread-300x192.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | Indian_cobra-150x150.jpg | 2022-10-19 08:17 | 8.3K | |
![[IMG]](/icons/image2.gif) | Stockley-Gardens-Fall-Arts-Festival-Credit-Roy-A-Barnes-585.jpg | 2022-10-19 08:17 | 64K | |
![[IMG]](/icons/image2.gif) | dangerous-cobra-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | localbonsdr-300x200.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | museum-civil-rights.jpg | 2022-10-19 08:17 | 91K | |
![[IMG]](/icons/image2.gif) | salgam-150x150.jpg | 2022-10-19 08:17 | 9.9K | |
![[IMG]](/icons/image2.gif) | turkish-food-samra-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | vegzongzi.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | 1-murtabak.jpg | 2022-10-19 08:17 | 33K | |
![[IMG]](/icons/image2.gif) | 51M7DHXP2FL._SS500_-300x300.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | 20831_zoom1-150x150.jpg | 2022-10-19 08:17 | 5.5K | |
![[IMG]](/icons/image2.gif) | 6327394131_ddb739906a_z-150x150.jpg | 2022-10-19 08:17 | 9.3K | |
![[IMG]](/icons/image2.gif) | Big-city.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | Phoenix 134-150x150.jpg | 2022-10-19 08:17 | 7.4K | |
![[IMG]](/icons/image2.gif) | SAM_3235.jpg | 2022-10-19 08:17 | 70K | |
![[IMG]](/icons/image2.gif) | cookingclasssy.jpg | 2022-10-19 08:17 | 63K | |
![[IMG]](/icons/image2.gif) | isteast5.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | khcali3-250x300.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | vegthaicurry-300x225.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | 1-318x350.jpg | 2022-10-19 08:17 | 64K | |
![[IMG]](/icons/image2.gif) | 4-150x150.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | 18873_zoom11.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | 20000_zoom1-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | Farmhouse-at-St-Fagans-Museum-150x150.jpg | 2022-10-19 08:17 | 6.9K | |
![[IMG]](/icons/image2.gif) | Fort-Norfolk-Credit-Roy-A-Barnes-585-150x150.jpg | 2022-10-19 08:17 | 7.3K | |
![[IMG]](/icons/image2.gif) | Sitting-Alone-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | flying-budget-768x512.jpg | 2022-10-19 08:17 | 67K | |
![[IMG]](/icons/image2.gif) | flying-departures.jpg | 2022-10-19 08:17 | 95K | |
![[IMG]](/icons/image2.gif) | flying-interior-150x150.jpg | 2022-10-19 08:17 | 7.4K | |
![[IMG]](/icons/image2.gif) | flying-ticket-640x428.jpg | 2022-10-19 08:17 | 56K | |
![[IMG]](/icons/image2.gif) | isteast9.jpg | 2022-10-19 08:17 | 39K | |
![[IMG]](/icons/image2.gif) | museum-kurt-V-150x150.jpg | 2022-10-19 08:17 | 7.7K | |
![[IMG]](/icons/image2.gif) | traveler-postcardiran-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | vegzongzi-300x201.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | 3-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 5-Aletria-300x208.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 10-Changi-Airport-MRT-Station-Singapore-150x150.jpg | 2022-10-19 08:17 | 9.8K | |
![[IMG]](/icons/image2.gif) | 18873_zoom1-150x150.jpg | 2022-10-19 08:17 | 4.1K | |
![[IMG]](/icons/image2.gif) | City_Of_Sails_Auckland-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | Elephant-390x585.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | Fattailed_scorpion.jpg | 2022-10-19 08:17 | 82K | |
![[IMG]](/icons/image2.gif) | Machu-Picchu-300x225.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | Zchi_bw_cr-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | angryellie-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | indie-thumbnail-banner-150x113.jpg | 2022-10-19 08:17 | 9.0K | |
![[IMG]](/icons/image2.gif) | photo(1)-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 4 - Sahara-150x150.jpg | 2022-10-19 08:17 | 7.3K | |
![[IMG]](/icons/image2.gif) | 5-Aletria-150x150.png | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | 9 - Kiva-350x252.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | Birds-Arrows-at-The-Jewish-Mother-585-Credit-Roy-A-Barnes.jpg | 2022-10-19 08:17 | 60K | |
![[IMG]](/icons/image2.gif) | Fort-Norfolk-Credit-Roy-A-Barnes-585.jpg | 2022-10-19 08:17 | 37K | |
![[IMG]](/icons/image2.gif) | Sydney-Australia-150x150.jpg | 2022-10-19 08:17 | 9.7K | |
![[IMG]](/icons/image2.gif) | alternative 7 - Deer at Sangatsu-do Hall, Nara, Japan-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | australiadannye.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | baby by ariplane window-150x150.jpg | 2022-10-19 08:17 | 6.3K | |
![[IMG]](/icons/image2.gif) | babyreadplane-150x150.jpg | 2022-10-19 08:17 | 9.1K | |
![[IMG]](/icons/image2.gif) | boxjellydanger.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | dangerous-lion-150x150.jpg | 2022-10-19 08:17 | 9.0K | |
![[IMG]](/icons/image2.gif) | istanbuleast2.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | losetouch-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 1-Ansicht-Art-Hotel-louise-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 3-Stockholm.jpg | 2022-10-19 08:17 | 38K | |
![[IMG]](/icons/image2.gif) | 3-transportzc-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 8 - Boudinath Temple, Nepal-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | Alone-150x150.jpg | 2022-10-19 08:17 | 9.7K | |
![[IMG]](/icons/image2.gif) | Turkish-Istanbul-copy-1024x559.jpg | 2022-10-19 08:17 | 70K | |
![[IMG]](/icons/image2.gif) | australiadannye-150x150.jpg | 2022-10-19 08:17 | 8.2K | |
![[IMG]](/icons/image2.gif) | badboysdr-300x300.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | georgiawab-300x225.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | global-basecamp-feature-150x150.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | museum-taliesin-150x150.jpg | 2022-10-19 08:17 | 8.2K | |
![[IMG]](/icons/image2.gif) | skyline_nyc_black1ck-300x180.jpg | 2022-10-19 08:17 | 6.2K | |
![[IMG]](/icons/image2.gif) | surfingsy-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | turkish-food-baklava.jpg | 2022-10-19 08:17 | 73K | |
![[IMG]](/icons/image2.gif) | yogaclassy-300x191.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | 1-Ansicht-Art-Hotel-louise.jpg | 2022-10-19 08:17 | 44K | |
![[IMG]](/icons/image2.gif) | 2-Marine-Conservation.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | 6-Animal-Species.jpg | 2022-10-19 08:17 | 48K | |
![[IMG]](/icons/image2.gif) | 7-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | Mosquito-585x523.jpg | 2022-10-19 08:17 | 67K | |
![[IMG]](/icons/image2.gif) | Polar_bears-300x196.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | Stockley-Gardens-Fall-Arts-Festival-Credit-Roy-A-Barnes-585-300x225.jpg | 2022-10-19 08:17 | 33K | |
![[IMG]](/icons/image2.gif) | Zchi_bw_cr-211x300.jpg | 2022-10-19 08:17 | 22K | |
![[IMG]](/icons/image2.gif) | babypack1011-300x225.jpg | 2022-10-19 08:17 | 26K | |
![[IMG]](/icons/image2.gif) | detroittday-300x225.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | museum-civil-rights-640x427.jpg | 2022-10-19 08:17 | 78K | |
![[IMG]](/icons/image2.gif) | museum-okeefe-640x480.jpg | 2022-10-19 08:17 | 48K | |
![[IMG]](/icons/image2.gif) | writing from the road-585x436.jpg | 2022-10-19 08:17 | 70K | |
![[IMG]](/icons/image2.gif) | 17825_zoom1-150x150.jpg | 2022-10-19 08:17 | 4.7K | |
![[IMG]](/icons/image2.gif) | DSC_2132-300x198.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | Indian_cobra-300x231.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | Saltwater_crocodile-585x390.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | bondgirldr.jpg | 2022-10-19 08:17 | 31K | |
![[IMG]](/icons/image2.gif) | couscouveg.jpg | 2022-10-19 08:17 | 50K | |
![[IMG]](/icons/image2.gif) | flyinglui4-150x150.jpg | 2022-10-19 08:17 | 8.5K | |
![[IMG]](/icons/image2.gif) | paintingsy.jpg | 2022-10-19 08:17 | 125K | |
![[IMG]](/icons/image2.gif) | romancetravel1011-300x224.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | smartmuseumchi-300x225.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | traveler-postcardiran.jpg | 2022-10-19 08:17 | 97K | |
![[IMG]](/icons/image2.gif) | 11-Kiev-150x150.jpg | 2022-10-19 08:17 | 7.6K | |
![[IMG]](/icons/image2.gif) | 13-North-Korea-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 1251830837_87ebde93ce_z-300x201.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | bondgirldr-300x200.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | flyinglui4-300x200.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | hotels-collage-5-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | mazatlan2-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | packlightbonddr-150x150.jpg | 2022-10-19 08:17 | 9.8K | |
![[IMG]](/icons/image2.gif) | saltcrocdanger10-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | sudanwab-300x199.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | tangosy-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 3-red-bean.jpg | 2022-10-19 08:17 | 31K | |
![[IMG]](/icons/image2.gif) | 5-Aletria.png | 2022-10-19 08:17 | 494K | |
![[IMG]](/icons/image2.gif) | 7-350x262.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | 7-mars-bar.jpg | 2022-10-19 08:17 | 73K | |
![[IMG]](/icons/image2.gif) | calikh1-300x199.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | costawab.jpg | 2022-10-19 08:17 | 123K | |
![[IMG]](/icons/image2.gif) | paintingsy-268x300.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | 4-Taiwan.jpg | 2022-10-19 08:17 | 48K | |
![[IMG]](/icons/image2.gif) | 9 - Kilimanjiro-150x150.jpg | 2022-10-19 08:17 | 4.6K | |
![[IMG]](/icons/image2.gif) | 51M7DHXP2FL._SS500_-150x150.jpg | 2022-10-19 08:17 | 6.4K | |
![[IMG]](/icons/image2.gif) | 640pxKokorec3-300x225.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | 3803609760_dd936cc417_z-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | Fufu.jpg | 2022-10-19 08:17 | 35K | |
![[IMG]](/icons/image2.gif) | Phoenix 074-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | Thanksgiving Day Parade New York photo by martha_chapa95 license cc-by-150x150.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | cristo redentor-150x150.jpg | 2022-10-19 08:17 | 9.1K | |
![[IMG]](/icons/image2.gif) | flying-nok.jpg | 2022-10-19 08:17 | 110K | |
![[IMG]](/icons/image2.gif) | museum-mutter-768x465.png | 2022-10-19 08:17 | 226K | |
![[IMG]](/icons/image2.gif) | photo(4)-150x150.jpg | 2022-10-19 08:17 | 5.9K | |
![[IMG]](/icons/image2.gif) | sarma-150x150.jpg | 2022-10-19 08:17 | 8.2K | |
![[IMG]](/icons/image2.gif) | scubasy-300x225.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 1-Ansicht-Art-Hotel-louise-300x254.jpg | 2022-10-19 08:17 | 26K | |
![[IMG]](/icons/image2.gif) | 6 - Remarkable Rocks, Australia-150x150.jpg | 2022-10-19 08:17 | 8.6K | |
![[IMG]](/icons/image2.gif) | 9918_575839226465_5406017_33494960_1409077_n-150x150.jpg | 2022-10-19 08:17 | 9.2K | |
![[IMG]](/icons/image2.gif) | 6350417033_604d9d4f33_z-300x225.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | Bread-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | Elderflower-150x150.jpg | 2022-10-19 08:17 | 6.3K | |
![[IMG]](/icons/image2.gif) | Mosquito-150x150.jpg | 2022-10-19 08:17 | 8.2K | |
![[IMG]](/icons/image2.gif) | flying-departures-768x512.jpg | 2022-10-19 08:17 | 60K | |
![[IMG]](/icons/image2.gif) | flying-nok-768x567.jpg | 2022-10-19 08:17 | 67K | |
![[IMG]](/icons/image2.gif) | flying-woman.jpg | 2022-10-19 08:17 | 63K | |
![[IMG]](/icons/image2.gif) | flyinglui2-150x150.jpg | 2022-10-19 08:17 | 7.7K | |
![[IMG]](/icons/image2.gif) | galapagosnye-300x200.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | hipsjoined1011-150x150.jpg | 2022-10-19 08:17 | 8.6K | |
![[IMG]](/icons/image2.gif) | hipsjoined1011-300x300.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | khcali5-150x150.jpg | 2022-10-19 08:17 | 7.4K | |
![[IMG]](/icons/image2.gif) | mazatlan7-150x150.jpg | 2022-10-19 08:17 | 9.4K | |
![[IMG]](/icons/image2.gif) | skyline_nyc_black1ck.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | 1 - Food offering for temple blessing - India-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | 10 - Hot springs and mud pools, New Zealand-383x585.jpg | 2022-10-19 08:17 | 41K | |
![[IMG]](/icons/image2.gif) | Blast-Furnaces-at-Blists-Hill-150x150.jpg | 2022-10-19 08:17 | 9.9K | |
![[IMG]](/icons/image2.gif) | Christstollen-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | Great-Wall-Simatai-300x198.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | Slow.jpg | 2022-10-19 08:17 | 49K | |
![[IMG]](/icons/image2.gif) | dangerous-scorpion-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | khcali5-300x199.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | meditationsy-225x300.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | reflections along The Nile.-585x438.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | saltcrocdanger10.jpg | 2022-10-19 08:17 | 70K | |
![[IMG]](/icons/image2.gif) | turkish-food-salgam-640x422.jpg | 2022-10-19 08:17 | 73K | |
![[IMG]](/icons/image2.gif) | vegkaputat-300x200.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | Sitting-Alone.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | 3-transportzc-300x225.jpg | 2022-10-19 08:17 | 33K | |
![[IMG]](/icons/image2.gif) | 8-Tofu.jpg | 2022-10-19 08:17 | 38K | |
![[IMG]](/icons/image2.gif) | 9-150x150.jpg | 2022-10-19 08:17 | 7.2K | |
![[IMG]](/icons/image2.gif) | 18873_zoom1-300x300.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 6327391137_a87ed443df_z.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | Box_jellyfish-328x585.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | babyreadplane-300x225.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | museum-Margaret-Mitchell.png | 2022-10-19 08:17 | 1.1M | |
![[IMG]](/icons/image2.gif) | 2011-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | Buffalo-585x438.jpg | 2022-10-19 08:17 | 65K | |
![[IMG]](/icons/image2.gif) | africanbuffalo1011-300x199.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | christmarktcoldwinter-300x300.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | gbc-feature-balloons.jpg | 2022-10-19 08:17 | 69K | |
![[IMG]](/icons/image2.gif) | museum-Margaret-Mitchell-640x441.png | 2022-10-19 08:17 | 498K | |
![[IMG]](/icons/image2.gif) | 5reindeercold.jpg | 2022-10-19 08:17 | 39K | |
![[IMG]](/icons/image2.gif) | 640px-Kokoreç-300x225.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | St-Pauls-Episcobal-Church-Credit-Roy-A-Barnes-585.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | cig kofte-150x150.jpg | 2022-10-19 08:17 | 8.9K | |
![[IMG]](/icons/image2.gif) | gblowingsy.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | 4-National-Park-150x150.jpg | 2022-10-19 08:17 | 9.2K | |
![[IMG]](/icons/image2.gif) | 9918_575839226465_5406017_33494960_1409077_n-585x438.jpg | 2022-10-19 08:17 | 57K | |
![[IMG]](/icons/image2.gif) | 18873_zoom1-1024x1024.jpg | 2022-10-19 08:17 | 74K | |
![[IMG]](/icons/image2.gif) | Museum.jpg | 2022-10-19 08:17 | 218K | |
![[IMG]](/icons/image2.gif) | SAM_3235-150x150.jpg | 2022-10-19 08:17 | 8.2K | |
![[IMG]](/icons/image2.gif) | SAM_3266.jpg | 2022-10-19 08:17 | 77K | |
![[IMG]](/icons/image2.gif) | 9918_575838971975_5406017_33494911_5485275_n-585x390.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | Elephant-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | africanbuffalo1011.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | boxjellydanger-150x150.jpg | 2022-10-19 08:17 | 7.4K | |
![[IMG]](/icons/image2.gif) | turkeyney-300x200.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | wall_decorations_paris-300x300.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 10930681.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | Chrysler-Museum-of-Art-Credit-Roy-A-Barnes-585-300x225.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | Venice.jpg | 2022-10-19 08:17 | 48K | |
![[IMG]](/icons/image2.gif) | Writer-Roy-A-Barnes-at-Norfolk-Waterfront-Credit-Roy-A-Barnes-585-1-300x225.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | ratatouliievge-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | turkish-manti-640x427.jpg | 2022-10-19 08:17 | 64K | |
![[IMG]](/icons/image2.gif) | 2-Kaohsiung-Station-Taiwan.jpg | 2022-10-19 08:17 | 56K | |
![[IMG]](/icons/image2.gif) | 1251830837_87ebde93ce_z-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | achsy.jpg | 2022-10-19 08:17 | 64K | |
![[IMG]](/icons/image2.gif) | deadly-hippo-150x150.jpg | 2022-10-19 08:17 | 8.3K | |
![[IMG]](/icons/image2.gif) | turkish-mussels-640x426.jpg | 2022-10-19 08:17 | 79K | |
![[IMG]](/icons/image2.gif) | vegetable thanksgiving turkey, photo by velo steve, license cc-by-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 4-Taiwan-300x225.jpg | 2022-10-19 08:17 | 30K | |
![[IMG]](/icons/image2.gif) | Dinner-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | Machu-Picchu-150x150.jpg | 2022-10-19 08:17 | 8.0K | |
![[IMG]](/icons/image2.gif) | dangerous-polar-bear.jpg | 2022-10-19 08:17 | 53K | |
![[IMG]](/icons/image2.gif) | flying-budget-640x427.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | turkish-lahmacun.jpg | 2022-10-19 08:17 | 90K | |
![[IMG]](/icons/image2.gif) | 3-transportzc.jpg | 2022-10-19 08:17 | 59K | |
![[IMG]](/icons/image2.gif) | Big-city-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | Great Wall - Simatai-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | Shanghai trip Nov24 2010 to Jan 20 2011 118-438x585.jpg | 2022-10-19 08:17 | 40K | |
![[IMG]](/icons/image2.gif) | chiBW-150x150.jpg | 2022-10-19 08:17 | 9.3K | |
![[IMG]](/icons/image2.gif) | kungfusy.jpg | 2022-10-19 08:17 | 71K | |
![[IMG]](/icons/image2.gif) | vegthaicurry-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 5-HotelFoxRoom-106-300x201.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | DSC_2059-300x198.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | Fufu-300x225.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | christmarktcoldwinter.jpg | 2022-10-19 08:17 | 43K | |
![[IMG]](/icons/image2.gif) | kids on airplane-150x150.jpg | 2022-10-19 08:17 | 8.4K | |
![[IMG]](/icons/image2.gif) | 5-Aletria.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | 6-Pelirocco2.jpg | 2022-10-19 08:17 | 40K | |
![[IMG]](/icons/image2.gif) | 10-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | Steak-Dinner-150x150.jpg | 2022-10-19 08:17 | 8.2K | |
![[IMG]](/icons/image2.gif) | museum-Margaret-Mitchell-768x529.jpg | 2022-10-19 08:17 | 53K | |
![[IMG]](/icons/image2.gif) | museum-smart-768x614.jpg | 2022-10-19 08:17 | 59K | |
![[IMG]](/icons/image2.gif) | museums-boats-640x381.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | postcard-russia-prices-150x150.png | 2022-10-19 08:17 | 4.1K | |
![[IMG]](/icons/image2.gif) | 3-Gladstone-hotel-300x204.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | costa-rica1 edited-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | dangerous-mosquito-150x150.jpg | 2022-10-19 08:17 | 4.9K | |
![[IMG]](/icons/image2.gif) | deadly-hippo.jpg | 2022-10-19 08:17 | 79K | |
![[IMG]](/icons/image2.gif) | kungfusy-300x225.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | mazatlan6-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | postcard-iran-prices.png | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | postcard-russia-prices-300x112.png | 2022-10-19 08:17 | 7.5K | |
![[IMG]](/icons/image2.gif) | 1-Environmental-Education-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 2-Marine-Conservation-300x187.jpg | 2022-10-19 08:17 | 22K | |
![[IMG]](/icons/image2.gif) | 7-Sandton_Hotel_De_Filosoof_Red_room2-300x204.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | DSC_2117-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | St-Pauls-Episcobal-Church-Credit-Roy-A-Barnes-585-300x225.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | photo(2)-150x150.jpg | 2022-10-19 08:17 | 4.2K | |
![[IMG]](/icons/image2.gif) | turkish-hamsi-640x427.jpg | 2022-10-19 08:17 | 43K | |
![[IMG]](/icons/image2.gif) | 3-Stockholm-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 8-Moscow-Slavyansky-Bulvar-300x198.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | Cruise-150x150.jpg | 2022-10-19 08:17 | 5.2K | |
![[IMG]](/icons/image2.gif) | Shanghai trip Nov24 2010 to Jan 20 2011 009-150x150.jpg | 2022-10-19 08:17 | 8.2K | |
![[IMG]](/icons/image2.gif) | hipsjoined1011.jpg | 2022-10-19 08:17 | 69K | |
![[IMG]](/icons/image2.gif) | khcali5.jpg | 2022-10-19 08:17 | 97K | |
![[IMG]](/icons/image2.gif) | 9 - Kiva-150x150.png | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | 9 - Kiva-350x252.png | 2022-10-19 08:17 | 143K | |
![[IMG]](/icons/image2.gif) | dangerous-mosquito.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | dodocase-560-blue-4-300x198.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | myfujinye-150x150.jpg | 2022-10-19 08:17 | 6.4K | |
![[IMG]](/icons/image2.gif) | photo(2)-391x585.jpg | 2022-10-19 08:17 | 26K | |
![[IMG]](/icons/image2.gif) | yogaclassy.jpg | 2022-10-19 08:17 | 58K | |
![[IMG]](/icons/image2.gif) | 3-1onesen-150x150.jpg | 2022-10-19 08:17 | 9.6K | |
![[IMG]](/icons/image2.gif) | 41Lwr6ZZm7L._SL1116_-150x150.jpg | 2022-10-19 08:17 | 4.0K | |
![[IMG]](/icons/image2.gif) | Behind the Chen Family compound-585x438.jpg | 2022-10-19 08:17 | 56K | |
![[IMG]](/icons/image2.gif) | Celebrating-like-a-local.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | dangerous-buffalo.jpg | 2022-10-19 08:17 | 67K | |
![[IMG]](/icons/image2.gif) | georgiawab.jpg | 2022-10-19 08:17 | 87K | |
![[IMG]](/icons/image2.gif) | khcali2-300x199.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | 2-Carbonzc-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 5-Animal-Rehab.jpg | 2022-10-19 08:17 | 33K | |
![[IMG]](/icons/image2.gif) | Dangerous-Animals-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | Fermented-Shark1.jpg | 2022-10-19 08:17 | 70K | |
![[IMG]](/icons/image2.gif) | Great Wall - Simatai-585x387.jpg | 2022-10-19 08:17 | 65K | |
![[IMG]](/icons/image2.gif) | australiadannye-199x300.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | flying-nok-640x472.jpg | 2022-10-19 08:17 | 50K | |
![[IMG]](/icons/image2.gif) | morocconightnye-300x181.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | 640pxKokorec3-150x150.jpg | 2022-10-19 08:17 | 9.0K | |
![[IMG]](/icons/image2.gif) | Pomegranates-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | Tiger Leaping Gorge-585x387.jpg | 2022-10-19 08:17 | 47K | |
![[IMG]](/icons/image2.gif) | angryhippos10.jpg | 2022-10-19 08:17 | 66K | |
![[IMG]](/icons/image2.gif) | baddiet-150x150.jpg | 2022-10-19 08:17 | 8.6K | |
![[IMG]](/icons/image2.gif) | disneytday-300x225.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | flying-ticket-768x513.jpg | 2022-10-19 08:17 | 76K | |
![[IMG]](/icons/image2.gif) | georgiawab-150x150.jpg | 2022-10-19 08:17 | 7.8K | |
![[IMG]](/icons/image2.gif) | isteast8-225x300.jpg | 2022-10-19 08:17 | 30K | |
![[IMG]](/icons/image2.gif) | isteast9-300x200.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | museum-mill-city-768x512.jpg | 2022-10-19 08:17 | 70K | |
![[IMG]](/icons/image2.gif) | samosasveg-300x225.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | southkoreawb-300x218.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | 1-Quebec-City-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 2-Marine-Conservation-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 3-1onesen-300x199.jpg | 2022-10-19 08:17 | 22K | |
![[IMG]](/icons/image2.gif) | Christstollen-300x199.jpg | 2022-10-19 08:17 | 22K | |
![[IMG]](/icons/image2.gif) | Hippo-585x390.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | Phoenix 077-585x438.jpg | 2022-10-19 08:17 | 41K | |
![[IMG]](/icons/image2.gif) | Planet-Earth-300x225.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | SAM_3235-300x221.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | galapagosnye.jpg | 2022-10-19 08:17 | 64K | |
![[IMG]](/icons/image2.gif) | mazatlan3-300x225.jpg | 2022-10-19 08:17 | 30K | |
![[IMG]](/icons/image2.gif) | museum-mutter-150x150.png | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | skyline_nyc_black1ck-150x150.jpg | 2022-10-19 08:17 | 3.5K | |
![[IMG]](/icons/image2.gif) | thailadnwab-300x201.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | 4 - Rowing between paddy fields, Vietnam-150x150.jpg | 2022-10-19 08:17 | 9.9K | |
![[IMG]](/icons/image2.gif) | 4 - Rowing between paddy fields, Vietnam-585x383.jpg | 2022-10-19 08:17 | 78K | |
![[IMG]](/icons/image2.gif) | 4-bread-and-butter.jpg | 2022-10-19 08:17 | 49K | |
![[IMG]](/icons/image2.gif) | 5-Animal-Rehab-300x225.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | 6-Animal-Species-300x199.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | 7sloveniacold-150x150.jpg | 2022-10-19 08:17 | 6.2K | |
![[IMG]](/icons/image2.gif) | Fermented-Shark.jpg | 2022-10-19 08:17 | 59K | |
![[IMG]](/icons/image2.gif) | Peking-Duck-150x150.jpg | 2022-10-19 08:17 | 8.7K | |
![[IMG]](/icons/image2.gif) | Thanksgiving Day Parade New York photo by martha_chapa95 license cc-by-585x389.jpg | 2022-10-19 08:17 | 53K | |
![[IMG]](/icons/image2.gif) | museum-minnetonka-640x479.jpg | 2022-10-19 08:17 | 43K | |
![[IMG]](/icons/image2.gif) | photo(5)-150x150.jpg | 2022-10-19 08:17 | 7.1K | |
![[IMG]](/icons/image2.gif) | santiago chile - view from up above-585x437.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | thailadnwab.jpg | 2022-10-19 08:17 | 69K | |
![[IMG]](/icons/image2.gif) | 7-Biodiversity-150x150.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | City_Of_Sails_Auckland-350x262.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | SAM_3433.jpg | 2022-10-19 08:17 | 75K | |
![[IMG]](/icons/image2.gif) | SAM_3451-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | Sichuan-Tibet Highway-150x150.jpg | 2022-10-19 08:17 | 7.3K | |
![[IMG]](/icons/image2.gif) | Turkish-cig-150x150.jpg | 2022-10-19 08:17 | 7.7K | |
![[IMG]](/icons/image2.gif) | boxjellydanger-300x199.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | everythingdirty.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | gbc-feature-balloons-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | global-basecamp-feature-300x244.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | istanbuleast2-300x200.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | isteats4-150x150.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | photoclasssy.jpg | 2022-10-19 08:17 | 40K | |
![[IMG]](/icons/image2.gif) | planmissiondr.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | turkish-kokorec.jpg | 2022-10-19 08:17 | 114K | |
![[IMG]](/icons/image2.gif) | turkish-manti-150x150.jpg | 2022-10-19 08:17 | 9.7K | |
![[IMG]](/icons/image2.gif) | 3-1onesen.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | 5-Animal-Rehab-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 5 - Eygpt-150x150.jpg | 2022-10-19 08:17 | 4.6K | |
![[IMG]](/icons/image2.gif) | 640pxKokorec3.jpg | 2022-10-19 08:17 | 43K | |
![[IMG]](/icons/image2.gif) | SAM_3270-150x150.jpg | 2022-10-19 08:17 | 8.2K | |
![[IMG]](/icons/image2.gif) | calikh1-150x150.jpg | 2022-10-19 08:17 | 9.7K | |
![[IMG]](/icons/image2.gif) | flying-interior-640x428.jpg | 2022-10-19 08:17 | 49K | |
![[IMG]](/icons/image2.gif) | flying-woman-640x425.jpg | 2022-10-19 08:17 | 59K | |
![[IMG]](/icons/image2.gif) | flying-woman-768x510.jpg | 2022-10-19 08:17 | 78K | |
![[IMG]](/icons/image2.gif) | morocconightnye.jpg | 2022-10-19 08:17 | 47K | |
![[IMG]](/icons/image2.gif) | museum-hemmingway.jpg | 2022-10-19 08:17 | 84K | |
![[IMG]](/icons/image2.gif) | noprivacy-225x300.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | photo(10)-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | skwabwab-300x218.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | vegarepa-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 2-Carbonzc-300x199.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | 2 - traditional farmer_'s dance, S. Korea-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 20000_zoom1-300x240.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | Higgins-Wharf-Underground-Railroad-Credit-Roy-A-Barnes-585-300x225.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | Lion-150x150.jpg | 2022-10-19 08:17 | 8.6K | |
![[IMG]](/icons/image2.gif) | The-Pit-at-Beamish.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | Tiger Leaping Gorge-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | disneytday.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | everythingdirty-150x150.jpg | 2022-10-19 08:17 | 9.4K | |
![[IMG]](/icons/image2.gif) | gblowingsy-150x150.jpg | 2022-10-19 08:17 | 7.5K | |
![[IMG]](/icons/image2.gif) | isteast9-150x150.jpg | 2022-10-19 08:17 | 9.4K | |
![[IMG]](/icons/image2.gif) | museum-mill-city.jpg | 2022-10-19 08:17 | 59K | |
![[IMG]](/icons/image2.gif) | museum-phillips-768x432.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | postcard-russia-prices.png | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | santiago chile - view from up above-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 5 - Chairman Mau directing traffic-585x383.jpg | 2022-10-19 08:17 | 57K | |
![[IMG]](/icons/image2.gif) | 9-Halva-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 12-Lisboa-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 2207345905_0faa9f56d0_z-150x150.jpg | 2022-10-19 08:17 | 6.5K | |
![[IMG]](/icons/image2.gif) | Buffalo-150x150.jpg | 2022-10-19 08:17 | 9.0K | |
![[IMG]](/icons/image2.gif) | Celebrating-like-a-local-150x150.jpg | 2022-10-19 08:17 | 9.7K | |
![[IMG]](/icons/image2.gif) | Museum-768x420.jpg | 2022-10-19 08:17 | 52K | |
![[IMG]](/icons/image2.gif) | Slow-150x150.jpg | 2022-10-19 08:17 | 9.1K | |
![[IMG]](/icons/image2.gif) | global-basecamp-feature.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | hotels-collage-6-150x150.jpg | 2022-10-19 08:17 | 8.9K | |
![[IMG]](/icons/image2.gif) | istanbuleast2-150x150.jpg | 2022-10-19 08:17 | 8.5K | |
![[IMG]](/icons/image2.gif) | museum-kurt-V-768x543.jpg | 2022-10-19 08:17 | 72K | |
![[IMG]](/icons/image2.gif) | museum-smart.jpg | 2022-10-19 08:17 | 99K | |
![[IMG]](/icons/image2.gif) | samosasveg-150x150.jpg | 2022-10-19 08:17 | 8.8K | |
![[IMG]](/icons/image2.gif) | skwabwab-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | techbonddr.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | turkish-food-samra-640x427.jpg | 2022-10-19 08:17 | 58K | |
![[IMG]](/icons/image2.gif) | 5-Supportzc-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 11-Kiev.jpg | 2022-10-19 08:17 | 68K | |
![[IMG]](/icons/image2.gif) | 9918_575839231455_5406017_33494961_1777984_n-585x438.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | 6327391137_a87ed443df_z-150x150.jpg | 2022-10-19 08:17 | 8.6K | |
![[IMG]](/icons/image2.gif) | Nauticus-Civil-War-Exhibits-Credit-Roy-A-Barnes-585-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | Packing-Cubes-150x150.jpg | 2022-10-19 08:17 | 9.7K | |
![[IMG]](/icons/image2.gif) | Shanghai trip Nov24 2010 to Jan 20 2011 005-585x438.jpg | 2022-10-19 08:17 | 57K | |
![[IMG]](/icons/image2.gif) | Sichuan-Tibet-Highway.jpg | 2022-10-19 08:17 | 55K | |
![[IMG]](/icons/image2.gif) | baddiet.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | flying.jpg | 2022-10-19 08:17 | 43K | |
![[IMG]](/icons/image2.gif) | newpeople-200x300.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | pyramidsnye.jpg | 2022-10-19 08:17 | 62K | |
![[IMG]](/icons/image2.gif) | vegkaputat.jpg | 2022-10-19 08:17 | 76K | |
![[IMG]](/icons/image2.gif) | 00141.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | 5reindeercold-300x225.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | 9-Hotel-Le-Monde-Atlantis-Room-1-150x150.jpg | 2022-10-19 08:17 | 7.4K | |
![[IMG]](/icons/image2.gif) | Fattailed_scorpion-300x225.jpg | 2022-10-19 08:17 | 31K | |
![[IMG]](/icons/image2.gif) | Hippo-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | costawab-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | flying-150x150.jpg | 2022-10-19 08:17 | 3.9K | |
![[IMG]](/icons/image2.gif) | flying-budget.jpg | 2022-10-19 08:17 | 52K | |
![[IMG]](/icons/image2.gif) | museum-hemmingway-640x427.jpg | 2022-10-19 08:17 | 71K | |
![[IMG]](/icons/image2.gif) | noprivacy-150x150.jpg | 2022-10-19 08:17 | 5.4K | |
![[IMG]](/icons/image2.gif) | okeefsf11-300x225.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | photo of my in Cairo-585x438.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | 1 - Food offering for temple blessing - India-383x585.jpg | 2022-10-19 08:17 | 43K | |
![[IMG]](/icons/image2.gif) | 6 - Remarkable Rocks, Australia-383x585.jpg | 2022-10-19 08:17 | 58K | |
![[IMG]](/icons/image2.gif) | 7-mars-bar-150x150.jpg | 2022-10-19 08:17 | 7.4K | |
![[IMG]](/icons/image2.gif) | 9-Halva.jpg | 2022-10-19 08:17 | 49K | |
![[IMG]](/icons/image2.gif) | 12-Lisboa-300x225.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | 5311587371_508ba09c08-350x262.jpg | 2022-10-19 08:17 | 33K | |
![[IMG]](/icons/image2.gif) | 5966318639_eaa1be2e81-350x262.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | 6312552257_d1618bcb64_z-300x199.jpg | 2022-10-19 08:17 | 37K | |
![[IMG]](/icons/image2.gif) | firstnye11.jpg | 2022-10-19 08:17 | 97K | |
![[IMG]](/icons/image2.gif) | flying-1024x561.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | outofshape.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | shoes, drink and phone-585x435.png | 2022-10-19 08:17 | 188K | |
![[IMG]](/icons/image2.gif) | turkish-kokorec-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 00141-150x150.jpg | 2022-10-19 08:17 | 8.0K | |
![[IMG]](/icons/image2.gif) | 4-Taiwan-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 5-HotelFoxRoom-106-150x150.jpg | 2022-10-19 08:17 | 6.9K | |
![[IMG]](/icons/image2.gif) | 9 - Wenslas Square, Prague, Czech Republic-150x150.jpg | 2022-10-19 08:17 | 9.2K | |
![[IMG]](/icons/image2.gif) | 13703_zoom1-300x236.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | Corkscrew-300x225.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | Corkscrew.jpg | 2022-10-19 08:17 | 33K | |
![[IMG]](/icons/image2.gif) | Peking-Duck.jpg | 2022-10-19 08:17 | 35K | |
![[IMG]](/icons/image2.gif) | angryhippos10-300x225.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | museum-civil-rights-768x512.jpg | 2022-10-19 08:17 | 56K | |
![[IMG]](/icons/image2.gif) | museum-kurt-V-640x452.jpg | 2022-10-19 08:17 | 54K | |
![[IMG]](/icons/image2.gif) | outofshape-225x300.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | ratatouliievge.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | vegthaicurry.jpg | 2022-10-19 08:17 | 58K | |
![[IMG]](/icons/image2.gif) | 2 - traditional farmer\'s dance, S. Korea-585x383.jpg | 2022-10-19 08:17 | 71K | |
![[IMG]](/icons/image2.gif) | 4-hotel-des-arts.jpg | 2022-10-19 08:17 | 62K | |
![[IMG]](/icons/image2.gif) | 316Ea4+y0ZL-273x300.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | 6312552257_d1618bcb64_z-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | 6350417033_604d9d4f33_z.jpg | 2022-10-19 08:17 | 56K | |
![[IMG]](/icons/image2.gif) | Dangerous-Animals.jpg | 2022-10-19 08:17 | 219K | |
![[IMG]](/icons/image2.gif) | SAM_3433-150x150.jpg | 2022-10-19 08:17 | 9.7K | |
![[IMG]](/icons/image2.gif) | dangerous-elephant.jpg | 2022-10-19 08:17 | 120K | |
![[IMG]](/icons/image2.gif) | museum-okeefe-768x576.jpg | 2022-10-19 08:17 | 65K | |
![[IMG]](/icons/image2.gif) | 1-Environmental-Education1.jpg | 2022-10-19 08:17 | 43K | |
![[IMG]](/icons/image2.gif) | 9-London.jpg | 2022-10-19 08:17 | 78K | |
![[IMG]](/icons/image2.gif) | 9918_575838986945_5406017_33494914_3342218_n-585x390.jpg | 2022-10-19 08:17 | 61K | |
![[IMG]](/icons/image2.gif) | 10930681-150x150.jpg | 2022-10-19 08:17 | 5.0K | |
![[IMG]](/icons/image2.gif) | Blast-Furnaces-at-Blists-Hill-300x225.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | DSC_2059.jpg | 2022-10-19 08:17 | 91K | |
![[IMG]](/icons/image2.gif) | cookingclasssy-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | costawabrica.jpg | 2022-10-19 08:17 | 66K | |
![[IMG]](/icons/image2.gif) | dangerous-box-jelly-150x150.jpg | 2022-10-19 08:17 | 6.9K | |
![[IMG]](/icons/image2.gif) | dangerous-buffalo-640x427.jpg | 2022-10-19 08:17 | 62K | |
![[IMG]](/icons/image2.gif) | flyinglui2.jpg | 2022-10-19 08:17 | 35K | |
![[IMG]](/icons/image2.gif) | localbonsdr-150x150.jpg | 2022-10-19 08:17 | 9.1K | |
![[IMG]](/icons/image2.gif) | mazatlan2-300x225.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | traveler-postcardiran-300x247.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | 1 - Charger-585x438.jpg | 2022-10-19 08:17 | 61K | |
![[IMG]](/icons/image2.gif) | 2-Daddy-Long-Legs-The-Fresh-Room-4-150x150.jpg | 2022-10-19 08:17 | 8.6K | |
![[IMG]](/icons/image2.gif) | 5-Toronto.jpg | 2022-10-19 08:17 | 59K | |
![[IMG]](/icons/image2.gif) | 10 - Cappadocia-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | Christstollen.jpg | 2022-10-19 08:17 | 43K | |
![[IMG]](/icons/image2.gif) | Fermented-Shark-300x154.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | Sydney-Australia-300x186.jpg | 2022-10-19 08:17 | 22K | |
![[IMG]](/icons/image2.gif) | dangerous-buffalo-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | dangerous-cobra-640x427.jpg | 2022-10-19 08:17 | 53K | |
![[IMG]](/icons/image2.gif) | deadly-croc-150x150.jpg | 2022-10-19 08:17 | 6.2K | |
![[IMG]](/icons/image2.gif) | khcali4-150x150.jpg | 2022-10-19 08:17 | 7.1K | |
![[IMG]](/icons/image2.gif) | more-pao-de-acucar-350x262.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | museum-mutter-640x388.png | 2022-10-19 08:17 | 168K | |
![[IMG]](/icons/image2.gif) | 2 - Lapland-150x150.jpg | 2022-10-19 08:17 | 9.2K | |
![[IMG]](/icons/image2.gif) | 4-bread-and-butter-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 4-tourzc-150x150.png | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | 20831_zoom1.jpg | 2022-10-19 08:17 | 37K | |
![[IMG]](/icons/image2.gif) | Dangerous-Animals-640x349.jpg | 2022-10-19 08:17 | 74K | |
![[IMG]](/icons/image2.gif) | Family-150x150.jpg | 2022-10-19 08:17 | 8.5K | |
![[IMG]](/icons/image2.gif) | Mosquito-300x268.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | Ramps-150x150.jpg | 2022-10-19 08:17 | 7.5K | |
![[IMG]](/icons/image2.gif) | cell-phone-lenses-2d14.0000001319065360.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | flying-ticket-150x150.jpg | 2022-10-19 08:17 | 8.5K | |
![[IMG]](/icons/image2.gif) | mjuadarraveg-300x200.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | ratatouliievge-300x200.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | vegkaputat-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | 1 - Christmas-150x150.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | 3-red-bean-300x199.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | 6-Localzc-300x200.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | 15-St-Petersburg-150x150.jpg | 2022-10-19 08:17 | 9.5K | |
![[IMG]](/icons/image2.gif) | 6261019982_5dd13b0457-150x150.jpg | 2022-10-19 08:17 | 6.9K | |
![[IMG]](/icons/image2.gif) | Domestique in the Tour De France-150x150.jpg | 2022-10-19 08:17 | 7.7K | |
![[IMG]](/icons/image2.gif) | Grapes-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | SAM_3266-150x150.jpg | 2022-10-19 08:17 | 4.4K | |
![[IMG]](/icons/image2.gif) | Sichuan-Tibet-Highway-150x150.jpg | 2022-10-19 08:17 | 7.1K | |
![[IMG]](/icons/image2.gif) | The-Pit-at-Beamish-150x150.jpg | 2022-10-19 08:17 | 9.4K | |
![[IMG]](/icons/image2.gif) | africanbuffalo1011-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | babyplane10112-300x184.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | cell-phone-lenses-2d14.0000001319065360-150x150.jpg | 2022-10-19 08:17 | 5.5K | |
![[IMG]](/icons/image2.gif) | dangerous-cobra.jpg | 2022-10-19 08:17 | 111K | |
![[IMG]](/icons/image2.gif) | isteats7-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | kungfusy-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | manti-150x150.jpg | 2022-10-19 08:17 | 7.8K | |
![[IMG]](/icons/image2.gif) | photo(3)-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | turkeyney-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 2 - traditional farmer\'s dance, S. Korea-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 5-Supportzc.jpg | 2022-10-19 08:17 | 44K | |
![[IMG]](/icons/image2.gif) | 6-Frankfurt-150x150.jpg | 2022-10-19 08:17 | 8.8K | |
![[IMG]](/icons/image2.gif) | 6-Pelirocco2-150x150.jpg | 2022-10-19 08:17 | 8.7K | |
![[IMG]](/icons/image2.gif) | 7-Sandton_Hotel_De_Filosoof_Red_room2-150x150.jpg | 2022-10-19 08:17 | 9.1K | |
![[IMG]](/icons/image2.gif) | 9918_575839316285_5406017_33494976_7487102_n-150x150.jpg | 2022-10-19 08:17 | 6.4K | |
![[IMG]](/icons/image2.gif) | Bread.jpg | 2022-10-19 08:17 | 43K | |
![[IMG]](/icons/image2.gif) | DSC_2077-300x198.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | Polar_bears.jpg | 2022-10-19 08:17 | 57K | |
![[IMG]](/icons/image2.gif) | Tiger-Leaping-Gorge-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | Una-don-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | losetouch.jpg | 2022-10-19 08:17 | 58K | |
![[IMG]](/icons/image2.gif) | museum-phillips-640x360.jpg | 2022-10-19 08:17 | 70K | |
![[IMG]](/icons/image2.gif) | museum-taliesin-640x479.jpg | 2022-10-19 08:17 | 75K | |
![[IMG]](/icons/image2.gif) | 1-Volunteerzc-300x179.jpg | 2022-10-19 08:17 | 30K | |
![[IMG]](/icons/image2.gif) | 2207345905_0faa9f56d0_z.jpg | 2022-10-19 08:17 | 40K | |
![[IMG]](/icons/image2.gif) | 6341752312_7270079867_z.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | Museum-640x350.jpg | 2022-10-19 08:17 | 70K | |
![[IMG]](/icons/image2.gif) | Stockley-Gardens-Fall-Arts-Festival-Credit-Roy-A-Barnes-585-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | Turkish-cig-640x427.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | Writer-Roy-A-Barnes-at-Norfolk-Waterfront-Credit-Roy-A-Barnes-585-1.jpg | 2022-10-19 08:17 | 48K | |
![[IMG]](/icons/image2.gif) | achsy-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | caribbeanthnksgiving-300x225.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | chilewab.jpg | 2022-10-19 08:17 | 59K | |
![[IMG]](/icons/image2.gif) | costa-rica3 edited-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | dangerous-thumb.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | museum-okeefe.jpg | 2022-10-19 08:17 | 110K | |
![[IMG]](/icons/image2.gif) | 3-Stockholm-300x199.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | 11-150x150.jpg | 2022-10-19 08:17 | 7.1K | |
![[IMG]](/icons/image2.gif) | 14-Washington-by-Genista-150x150.jpg | 2022-10-19 08:17 | 9.4K | |
![[IMG]](/icons/image2.gif) | 9918_575838986945_5406017_33494914_3342218_n-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | 17825_zoom1-300x260.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 6261019982_5dd13b0457-350x112.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | gazpachoveg.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | mazatlan2.jpg | 2022-10-19 08:17 | 68K | |
![[IMG]](/icons/image2.gif) | mazatlan7.jpg | 2022-10-19 08:17 | 66K | |
![[IMG]](/icons/image2.gif) | museum-taliesin.jpg | 2022-10-19 08:17 | 86K | |
![[IMG]](/icons/image2.gif) | photo of my in Cairo-150x150.jpg | 2022-10-19 08:17 | 6.4K | |
![[IMG]](/icons/image2.gif) | surfingsy.jpg | 2022-10-19 08:17 | 54K | |
![[IMG]](/icons/image2.gif) | turkish-lahmacun-640x427.jpg | 2022-10-19 08:17 | 79K | |
![[IMG]](/icons/image2.gif) | 1-233x350.jpg | 2022-10-19 08:17 | 31K | |
![[IMG]](/icons/image2.gif) | 1 - Charger-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 2-Kaohsiung-Station-Taiwan-300x199.jpg | 2022-10-19 08:17 | 33K | |
![[IMG]](/icons/image2.gif) | 12-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | Venice-300x213.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | babyreadplane.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | badboysdr-150x150.jpg | 2022-10-19 08:17 | 6.6K | |
![[IMG]](/icons/image2.gif) | calikh1.jpg | 2022-10-19 08:17 | 109K | |
![[IMG]](/icons/image2.gif) | flying-budget-150x150.jpg | 2022-10-19 08:17 | 7.3K | |
![[IMG]](/icons/image2.gif) | hotels-collage-2-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | isteast6-150x150.jpg | 2022-10-19 08:17 | 8.0K | |
![[IMG]](/icons/image2.gif) | mazatlan7-300x225.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | pao de açucar , rj.01jpg-150x150.jpg | 2022-10-19 08:17 | 6.8K | |
![[IMG]](/icons/image2.gif) | tangosy-300x200.jpg | 2022-10-19 08:17 | 26K | |
![[IMG]](/icons/image2.gif) | 2-Daddy-Long-Legs-The-Fresh-Room-4.jpg | 2022-10-19 08:17 | 76K | |
![[IMG]](/icons/image2.gif) | 9-London-300x199.jpg | 2022-10-19 08:17 | 22K | |
![[IMG]](/icons/image2.gif) | 10 - Hot springs and mud pools, New Zealand-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 13-North-Korea.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | 9918_575839286345_5406017_33494971_6067071_n-585x438.jpg | 2022-10-19 08:17 | 44K | |
![[IMG]](/icons/image2.gif) | Phoenix 132-350x244.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | Steak-Dinner.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | babyplane10112-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | flyinglui3-150x150.jpg | 2022-10-19 08:17 | 9.2K | |
![[IMG]](/icons/image2.gif) | gazpachoveg-300x200.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | istanbuleats3-300x225.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | isteast8-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | khcali6-300x199.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | maplesugarsnow-300x200.jpg | 2022-10-19 08:17 | 26K | |
![[IMG]](/icons/image2.gif) | museum-6th-floor-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | myfujinye-300x199.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | tuekrytday-300x225.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | 1-150x150.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | 6-Frankfurt.jpg | 2022-10-19 08:17 | 47K | |
![[IMG]](/icons/image2.gif) | 7 - Tiger-150x150.jpg | 2022-10-19 08:17 | 8.0K | |
![[IMG]](/icons/image2.gif) | 6327394131_ddb739906a_z-300x199.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | Ramps.jpg | 2022-10-19 08:17 | 62K | |
![[IMG]](/icons/image2.gif) | Rio-de-Janeiro-Brazil-300x199.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | Saltwater_crocodile-150x150.jpg | 2022-10-19 08:17 | 9.8K | |
![[IMG]](/icons/image2.gif) | Sichuan-Tibet-Highway-300x128.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | Sunset-150x150.jpg | 2022-10-19 08:17 | 6.2K | |
![[IMG]](/icons/image2.gif) | baddiet-300x225.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | bondgirldr-150x150.jpg | 2022-10-19 08:17 | 9.7K | |
![[IMG]](/icons/image2.gif) | khcali3.jpg | 2022-10-19 08:17 | 66K | |
![[IMG]](/icons/image2.gif) | museum-phillips.jpg | 2022-10-19 08:17 | 84K | |
![[IMG]](/icons/image2.gif) | nyctday-300x199.jpg | 2022-10-19 08:17 | 32K | |
![[IMG]](/icons/image2.gif) | paintingsy-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | postcard-iran-prices-150x150.png | 2022-10-19 08:17 | 4.8K | |
![[IMG]](/icons/image2.gif) | 1-Volunteerzc.jpg | 2022-10-19 08:17 | 54K | |
![[IMG]](/icons/image2.gif) | LuluLemon Athletica-150x150.jpg | 2022-10-19 08:17 | 6.9K | |
![[IMG]](/icons/image2.gif) | Ramps-300x199.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | The-Pit-at-Beamish-300x204.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | Turkish-Istanbul-copy-640x350.jpg | 2022-10-19 08:17 | 58K | |
![[IMG]](/icons/image2.gif) | dangerous-scorpion-640x427.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | dodocase-560-blue-4.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | flyinglui2-300x225.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | museum-cable-car.jpg | 2022-10-19 08:17 | 162K | |
![[IMG]](/icons/image2.gif) | turkish-food-salgam.jpg | 2022-10-19 08:17 | 81K | |
![[IMG]](/icons/image2.gif) | 3-Rainforest-Conservation-300x230.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | 8-Moscow-Slavyansky-Bulvar-150x150.jpg | 2022-10-19 08:17 | 9.3K | |
![[IMG]](/icons/image2.gif) | 640px-Kokoreç.jpg | 2022-10-19 08:17 | 63K | |
![[IMG]](/icons/image2.gif) | isnatnbuleats1.jpg | 2022-10-19 08:17 | 30K | |
![[IMG]](/icons/image2.gif) | mjuadarraveg.jpg | 2022-10-19 08:17 | 41K | |
![[IMG]](/icons/image2.gif) | museum-minnetonka-768x575.jpg | 2022-10-19 08:17 | 57K | |
![[IMG]](/icons/image2.gif) | museum-mutter.png | 2022-10-19 08:17 | 279K | |
![[IMG]](/icons/image2.gif) | nyekilisummit-150x150.jpg | 2022-10-19 08:17 | 8.7K | |
![[IMG]](/icons/image2.gif) | writing from the road-150x150.jpg | 2022-10-19 08:17 | 9.5K | |
![[IMG]](/icons/image2.gif) | 0661064179-150x150.jpg | 2022-10-19 08:17 | 6.1K | |
![[IMG]](/icons/image2.gif) | 2-Scotland-whisky.jpg | 2022-10-19 08:17 | 49K | |
![[IMG]](/icons/image2.gif) | 8 - Boudinath Temple, Nepal-383x585.jpg | 2022-10-19 08:17 | 72K | |
![[IMG]](/icons/image2.gif) | 18873_zoom11-300x300.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 5966318639_eaa1be2e81-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | SAM_3270.jpg | 2022-10-19 08:17 | 63K | |
![[IMG]](/icons/image2.gif) | SAM_3433-300x214.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | Slow-300x199.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | baby by ariplane window-262x350.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | babyplane10112.jpg | 2022-10-19 08:17 | 41K | |
![[IMG]](/icons/image2.gif) | costawabrica-300x200.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | dangerous-polar-bear-150x150.jpg | 2022-10-19 08:17 | 6.6K | |
![[IMG]](/icons/image2.gif) | isteast5-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | mazatlan4-150x150.jpg | 2022-10-19 08:17 | 9.7K | |
![[IMG]](/icons/image2.gif) | turkish-hamsi-150x150.jpg | 2022-10-19 08:17 | 9.9K | |
![[IMG]](/icons/image2.gif) | 3-Rainforest-Conservation-150x150.jpg | 2022-10-19 08:17 | 6.1K | |
![[IMG]](/icons/image2.gif) | 3 - Wind charger-350x191.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | 6-Pelirocco2-300x226.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | 9-Hotel-Le-Monde-Atlantis-Room-1-300x199.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | 316Ea4+y0ZL.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | 640px-Kokoreç3.jpg | 2022-10-19 08:17 | 63K | |
![[IMG]](/icons/image2.gif) | 20000_zoom1.jpg | 2022-10-19 08:17 | 32K | |
![[IMG]](/icons/image2.gif) | Fermented-Shark1-300x199.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | Higgins-Wharf-Underground-Railroad-Credit-Roy-A-Barnes-585-150x150.jpg | 2022-10-19 08:17 | 8.7K | |
![[IMG]](/icons/image2.gif) | Indiapic1-150x150.jpg | 2022-10-19 08:17 | 9.8K | |
![[IMG]](/icons/image2.gif) | Indiapic2-233x350.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | Mayflower II in Plymouth photo by dicktay2000, license cc-by-390x585.jpg | 2022-10-19 08:17 | 78K | |
![[IMG]](/icons/image2.gif) | Nauticus-Civil-War-Exhibits-Credit-Roy-A-Barnes-585.jpg | 2022-10-19 08:17 | 72K | |
![[IMG]](/icons/image2.gif) | Rio-de-Janeiro-Brazil-150x150.jpg | 2022-10-19 08:17 | 7.6K | |
![[IMG]](/icons/image2.gif) | geogriaiwab-300x225.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | hotels-collage-4-150x150.jpg | 2022-10-19 08:17 | 8.3K | |
![[IMG]](/icons/image2.gif) | khcali6.jpg | 2022-10-19 08:17 | 94K | |
![[IMG]](/icons/image2.gif) | mazatlan1-150x150.jpg | 2022-10-19 08:17 | 7.3K | |
![[IMG]](/icons/image2.gif) | turkeyney.jpg | 2022-10-19 08:17 | 48K | |
![[IMG]](/icons/image2.gif) | 1-Environmental-Education1-300x199.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | 4-tourzc-300x195.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 7-Biodiversity.jpg | 2022-10-19 08:17 | 73K | |
![[IMG]](/icons/image2.gif) | Museum-1024x559.jpg | 2022-10-19 08:17 | 81K | |
![[IMG]](/icons/image2.gif) | couscouveg-300x236.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | flying-departures-640x427.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | galapagosnye-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | isteats7-300x225.jpg | 2022-10-19 08:17 | 26K | |
![[IMG]](/icons/image2.gif) | khcali4.jpg | 2022-10-19 08:17 | 91K | |
![[IMG]](/icons/image2.gif) | museums-apothecary.jpg | 2022-10-19 08:17 | 62K | |
![[IMG]](/icons/image2.gif) | outofshape-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | papasveg-300x199.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | 2-Carbonzc.jpg | 2022-10-19 08:17 | 50K | |
![[IMG]](/icons/image2.gif) | 2-Scotland-whisky-300x300.jpg | 2022-10-19 08:17 | 33K | |
![[IMG]](/icons/image2.gif) | 3-Gladstone-hotel.jpg | 2022-10-19 08:17 | 50K | |
![[IMG]](/icons/image2.gif) | 5-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 6-Localzc-150x150.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | 6315475938_8b7afbf5f6_z-300x300.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | Lion-585x390.jpg | 2022-10-19 08:17 | 56K | |
![[IMG]](/icons/image2.gif) | Nauticus-Civil-War-Exhibits-Credit-Roy-A-Barnes-585-300x225.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | Shanghai trip Nov24 2010 to Jan 20 2011 009-585x438.jpg | 2022-10-19 08:17 | 67K | |
![[IMG]](/icons/image2.gif) | St-Pauls-Episcobal-Church-Credit-Roy-A-Barnes-585-150x150.jpg | 2022-10-19 08:17 | 7.4K | |
![[IMG]](/icons/image2.gif) | baklava-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | chiBW.jpg | 2022-10-19 08:17 | 55K | |
![[IMG]](/icons/image2.gif) | museum-mill-city-150x150.jpg | 2022-10-19 08:17 | 9.0K | |
![[IMG]](/icons/image2.gif) | museum-mutter-768x465.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | nyctday.jpg | 2022-10-19 08:17 | 69K | |
![[IMG]](/icons/image2.gif) | vegarepa.jpg | 2022-10-19 08:17 | 47K | |
![[IMG]](/icons/image2.gif) | 7-Shanghai.jpg | 2022-10-19 08:17 | 70K | |
![[IMG]](/icons/image2.gif) | 7sloveniacold.jpg | 2022-10-19 08:17 | 59K | |
![[IMG]](/icons/image2.gif) | 9918_575839231455_5406017_33494961_1777984_n-150x150.jpg | 2022-10-19 08:17 | 8.4K | |
![[IMG]](/icons/image2.gif) | 6341752312_7270079867_z-150x150.jpg | 2022-10-19 08:17 | 9.3K | |
![[IMG]](/icons/image2.gif) | Fort-Norfolk-Credit-Roy-A-Barnes-585-300x225.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | Una-don-300x225.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | isteast6.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | isteats4-300x225.jpg | 2022-10-19 08:17 | 38K | |
![[IMG]](/icons/image2.gif) | midye-262x350.jpg | 2022-10-19 08:17 | 35K | |
![[IMG]](/icons/image2.gif) | museums-boats-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | newpeople.jpg | 2022-10-19 08:17 | 48K | |
![[IMG]](/icons/image2.gif) | photo(9)-150x150.jpg | 2022-10-19 08:17 | 5.7K | |
![[IMG]](/icons/image2.gif) | techbonddr-300x209.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | turkish-food-baklava-640x480.jpg | 2022-10-19 08:17 | 70K | |
![[IMG]](/icons/image2.gif) | 4-tourzc.png | 2022-10-19 08:17 | 466K | |
![[IMG]](/icons/image2.gif) | 9-London-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | istanbuleats3.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | monemonster1011-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | museum-thumb.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | reflections along The Nile.-150x150.jpg | 2022-10-19 08:17 | 5.8K | |
![[IMG]](/icons/image2.gif) | romancetravel1011.jpg | 2022-10-19 08:17 | 54K | |
![[IMG]](/icons/image2.gif) | 1-Volunteerzc-150x150.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | 6-wasabi-ice-cream-150x150.jpg | 2022-10-19 08:17 | 8.0K | |
![[IMG]](/icons/image2.gif) | 9918_575839316285_5406017_33494976_7487102_n-585x438.jpg | 2022-10-19 08:17 | 37K | |
![[IMG]](/icons/image2.gif) | Elderflower.jpg | 2022-10-19 08:17 | 72K | |
![[IMG]](/icons/image2.gif) | Fufu-150x150.jpg | 2022-10-19 08:17 | 8.5K | |
![[IMG]](/icons/image2.gif) | Polar_bears-585x383.jpg | 2022-10-19 08:17 | 54K | |
![[IMG]](/icons/image2.gif) | Sitting-Alone-300x253.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | gbc-feature-balloons-300x244.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | iPad-300x205.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | mazatlan5-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | papasveg.jpg | 2022-10-19 08:17 | 38K | |
![[IMG]](/icons/image2.gif) | photo-150x150.jpg | 2022-10-19 08:17 | 6.1K | |
![[IMG]](/icons/image2.gif) | turkish-food-baklava-150x150.jpg | 2022-10-19 08:17 | 9.3K | |
![[IMG]](/icons/image2.gif) | 3 - Lagoon and desert amidst the Andes, Bolivia-585x383.jpg | 2022-10-19 08:17 | 52K | |
![[IMG]](/icons/image2.gif) | 18873_zoom1.jpg | 2022-10-19 08:17 | 55K | |
![[IMG]](/icons/image2.gif) | 6327391137_a87ed443df_z-300x199.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | Rio-de-Janeiro-Brazil.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | disneytday-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | firstnye11-150x150.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | hamsi-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | isteats4.jpg | 2022-10-19 08:17 | 78K | |
![[IMG]](/icons/image2.gif) | mazatlan3-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | mazatlan4-300x225.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | mazatlan5.jpg | 2022-10-19 08:17 | 77K | |
![[IMG]](/icons/image2.gif) | museum-hemmingway-150x150.jpg | 2022-10-19 08:17 | 8.4K | |
![[IMG]](/icons/image2.gif) | museums-apothecary-150x150.jpg | 2022-10-19 08:17 | 8.2K | |
![[IMG]](/icons/image2.gif) | vegzongzi-150x150.jpg | 2022-10-19 08:17 | 8.7K | |
![[IMG]](/icons/image2.gif) | 0661064179-300x300.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | 640px-Kokoreç3-150x150.jpg | 2022-10-19 08:17 | 9.1K | |
![[IMG]](/icons/image2.gif) | DSC_2117.jpg | 2022-10-19 08:17 | 96K | |
![[IMG]](/icons/image2.gif) | SAM_3266-300x225.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | babypack1011-150x150.jpg | 2022-10-19 08:17 | 9.9K | |
![[IMG]](/icons/image2.gif) | flying-768x420.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | hotels-collage-3-350x116.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | indie-thumbnail-banner.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | mazatlan4.jpg | 2022-10-19 08:17 | 65K | |
![[IMG]](/icons/image2.gif) | monemonster1011.jpg | 2022-10-19 08:17 | 56K | |
![[IMG]](/icons/image2.gif) | museum-thumb-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | postcard-iran-prices-300x112.png | 2022-10-19 08:17 | 7.6K | |
![[IMG]](/icons/image2.gif) | skwabwab.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | turkish-thumb.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | 3-585x438.jpg | 2022-10-19 08:17 | 49K | |
![[IMG]](/icons/image2.gif) | 4-tourzc.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | 10-Changi-Airport-MRT-Station-Singapore-300x199.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | 1251830837_87ebde93ce_z.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | Auckland_city-585x388.jpg | 2022-10-19 08:17 | 62K | |
![[IMG]](/icons/image2.gif) | Machu-Picchu.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | Phoenix 065-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | christmarktcoldwinter-150x150.jpg | 2022-10-19 08:17 | 8.8K | |
![[IMG]](/icons/image2.gif) | dangerous-lion.jpg | 2022-10-19 08:17 | 102K | |
![[IMG]](/icons/image2.gif) | flying-thumb-150x150.jpg | 2022-10-19 08:17 | 3.9K | |
![[IMG]](/icons/image2.gif) | midye-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | techbonddr-150x150.jpg | 2022-10-19 08:17 | 9.2K | |
![[IMG]](/icons/image2.gif) | 1-Montreal-Champ-de-Mars-Station-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 10930681-300x246.jpg | 2022-10-19 08:17 | 9.3K | |
![[IMG]](/icons/image2.gif) | Canal-Basin-at-Black-Country-Living-Museum.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | Indian_cobra.jpg | 2022-10-19 08:17 | 40K | |
![[IMG]](/icons/image2.gif) | cell-phone-lenses-2d14.0000001319065360-300x176.jpg | 2022-10-19 08:17 | 9.1K | |
![[IMG]](/icons/image2.gif) | cookingclasssy-300x200.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | dangerous-thumb-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | everythingdirty-585x390.jpg | 2022-10-19 08:17 | 58K | |
![[IMG]](/icons/image2.gif) | losetouch-585x438.jpg | 2022-10-19 08:17 | 44K | |
![[IMG]](/icons/image2.gif) | maplesugarsnow.jpg | 2022-10-19 08:17 | 60K | |
![[IMG]](/icons/image2.gif) | museum-mutter.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | wall_decorations_paris-150x150.jpg | 2022-10-19 08:17 | 4.4K | |
![[IMG]](/icons/image2.gif) | yogaclassy-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 1-Environmental-Education.jpg | 2022-10-19 08:17 | 43K | |
![[IMG]](/icons/image2.gif) | 2-Daddy-Long-Legs-The-Fresh-Room-4-300x201.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | 2-Kaohsiung-Station-Taiwan-150x150.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | 6-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 15-St-Petersburg.jpg | 2022-10-19 08:17 | 37K | |
![[IMG]](/icons/image2.gif) | 6327394131_ddb739906a_z.jpg | 2022-10-19 08:17 | 38K | |
![[IMG]](/icons/image2.gif) | Chrysler-Museum-of-Art-Credit-Roy-A-Barnes-585.jpg | 2022-10-19 08:17 | 49K | |
![[IMG]](/icons/image2.gif) | Pomegranates.jpg | 2022-10-19 08:17 | 65K | |
![[IMG]](/icons/image2.gif) | dangerous-box-jelly.jpg | 2022-10-19 08:17 | 40K | |
![[IMG]](/icons/image2.gif) | dangerous-polar-bear-640x427.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | shoes, drink and phone-150x150.png | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | turkish-food-samra.jpg | 2022-10-19 08:17 | 62K | |
![[IMG]](/icons/image2.gif) | 5-585x390.jpg | 2022-10-19 08:17 | 39K | |
![[IMG]](/icons/image2.gif) | 18873_zoom11-150x150.jpg | 2022-10-19 08:17 | 4.1K | |
![[IMG]](/icons/image2.gif) | 6341752312_7270079867_z-300x225.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | Canal-Basin-at-Black-Country-Living-Museum-300x190.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | Eastbridge-Windpump-at-Museum-of-East-Anglian-Life.jpg | 2022-10-19 08:17 | 44K | |
![[IMG]](/icons/image2.gif) | Sichuan-Tibet Highway-585x250.jpg | 2022-10-19 08:17 | 39K | |
![[IMG]](/icons/image2.gif) | Truffle-300x300.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | Writer-Roy-A-Barnes-at-Norfolk-Waterfront-Credit-Roy-A-Barnes-585-1-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | flyinglui1-150x150.jpg | 2022-10-19 08:17 | 7.1K | |
![[IMG]](/icons/image2.gif) | kids on airplane-227x350.jpg | 2022-10-19 08:17 | 22K | |
![[IMG]](/icons/image2.gif) | museum-phillips-150x150.jpg | 2022-10-19 08:17 | 9.3K | |
![[IMG]](/icons/image2.gif) | planmissiondr-300x200.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | turkish-manti.jpg | 2022-10-19 08:17 | 64K | |
![[IMG]](/icons/image2.gif) | 6315475938_8b7afbf5f6_z.jpg | 2022-10-19 08:17 | 59K | |
![[IMG]](/icons/image2.gif) | Behind the Chen Family compound-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | Birds-Arrows-at-The-Jewish-Mother-585-Credit-Roy-A-Barnes-150x150.jpg | 2022-10-19 08:17 | 6.6K | |
![[IMG]](/icons/image2.gif) | BuranoWindow-300x199.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | DSC_2059-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | Family-300x221.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | chiBW-213x300.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | deadly-croc.jpg | 2022-10-19 08:17 | 50K | |
![[IMG]](/icons/image2.gif) | flying-woman-150x150.jpg | 2022-10-19 08:17 | 8.2K | |
![[IMG]](/icons/image2.gif) | khcali3-150x150.jpg | 2022-10-19 08:17 | 5.4K | |
![[IMG]](/icons/image2.gif) | museum-kurt-V.jpg | 2022-10-19 08:17 | 57K | |
![[IMG]](/icons/image2.gif) | museum-smart-150x150.jpg | 2022-10-19 08:17 | 8.3K | |
![[IMG]](/icons/image2.gif) | nyekilisummit.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | samosasveg.jpg | 2022-10-19 08:17 | 78K | |
![[IMG]](/icons/image2.gif) | turkish-mussels.jpg | 2022-10-19 08:17 | 88K | |
![[IMG]](/icons/image2.gif) | vegetable thanksgiving turkey, photo by velo steve, license cc-by-585x389.jpg | 2022-10-19 08:17 | 72K | |
![[IMG]](/icons/image2.gif) | 2-Tavuk.jpg | 2022-10-19 08:17 | 31K | |
![[IMG]](/icons/image2.gif) | 8-Moscow-Slavyansky-Bulvar.jpg | 2022-10-19 08:17 | 66K | |
![[IMG]](/icons/image2.gif) | 9918_575838971975_5406017_33494911_5485275_n-150x150.jpg | 2022-10-19 08:17 | 6.0K | |
![[IMG]](/icons/image2.gif) | 9918_575839286345_5406017_33494971_6067071_n-150x150.jpg | 2022-10-19 08:17 | 6.9K | |
![[IMG]](/icons/image2.gif) | Tiger-Leaping-Gorge-300x198.jpg | 2022-10-19 08:17 | 26K | |
![[IMG]](/icons/image2.gif) | angryellie.jpg | 2022-10-19 08:17 | 93K | |
![[IMG]](/icons/image2.gif) | flying-interior.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | hotels-collage-1-150x150.jpg | 2022-10-19 08:17 | 9.6K | |
![[IMG]](/icons/image2.gif) | isteast5-300x168.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | maplesugarsnow-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | monemonster1011-300x225.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | museum-hemmingway-768x512.jpg | 2022-10-19 08:17 | 50K | |
![[IMG]](/icons/image2.gif) | 2 - traditional farmer_'s dance, S. Korea-585x383.jpg | 2022-10-19 08:17 | 71K | |
![[IMG]](/icons/image2.gif) | 3 - Wind charger-150x150.jpg | 2022-10-19 08:17 | 6.6K | |
![[IMG]](/icons/image2.gif) | 7-mars-bar-300x199.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | 30347_zoom1.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | 6327403275_963f60d62b_z-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | Birds-Arrows-at-The-Jewish-Mother-585-Credit-Roy-A-Barnes-300x225.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | Eastbridge-Windpump-at-Museum-of-East-Anglian-Life-150x150.jpg | 2022-10-19 08:17 | 8.7K | |
![[IMG]](/icons/image2.gif) | Fattailed_scorpion-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | Grapes-300x251.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | Packing-Cubes.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | baddiet-585x438.jpg | 2022-10-19 08:17 | 63K | |
![[IMG]](/icons/image2.gif) | bunnychowveg.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | meditationsy-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | photo(4)-390x585.jpg | 2022-10-19 08:17 | 33K | |
![[IMG]](/icons/image2.gif) | thailadnwab-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | turkish-food-meze-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 8-Tofu-150x150.jpg | 2022-10-19 08:17 | 8.0K | |
![[IMG]](/icons/image2.gif) | Farmhouse-at-St-Fagans-Museum-300x225.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | Turkish-Istanbul-copy.jpg | 2022-10-19 08:17 | 212K | |
![[IMG]](/icons/image2.gif) | caribbeanthnksgiving-150x150.jpg | 2022-10-19 08:17 | 5.8K | |
![[IMG]](/icons/image2.gif) | flyinglui1-300x225.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | isteast8.jpg | 2022-10-19 08:17 | 61K | |
![[IMG]](/icons/image2.gif) | khcali4-300x199.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | localbonsdr.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | losetouch-300x225.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | papasveg-150x150.jpg | 2022-10-19 08:17 | 8.4K | |
![[IMG]](/icons/image2.gif) | romanticlife-585x389.jpg | 2022-10-19 08:17 | 67K | |
![[IMG]](/icons/image2.gif) | 1-murtabak-150x150.jpg | 2022-10-19 08:17 | 9.8K | |
![[IMG]](/icons/image2.gif) | 2-Scotland-whisky-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 8 - Galapagos-150x150.jpg | 2022-10-19 08:17 | 9.2K | |
![[IMG]](/icons/image2.gif) | Farmhouse-at-St-Fagans-Museum.jpg | 2022-10-19 08:17 | 39K | |
![[IMG]](/icons/image2.gif) | costa-rica4 edited-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | detroittday-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | detroittday.jpg | 2022-10-19 08:17 | 79K | |
![[IMG]](/icons/image2.gif) | flying-640x350.jpg | 2022-10-19 08:17 | 22K | |
![[IMG]](/icons/image2.gif) | flying-interior-768x513.jpg | 2022-10-19 08:17 | 66K | |
![[IMG]](/icons/image2.gif) | mazatlan6.jpg | 2022-10-19 08:17 | 65K | |
![[IMG]](/icons/image2.gif) | morocconightnye-150x150.jpg | 2022-10-19 08:17 | 9.9K | |
![[IMG]](/icons/image2.gif) | museums-boats-768x458.jpg | 2022-10-19 08:17 | 63K | |
![[IMG]](/icons/image2.gif) | myfujinye.jpg | 2022-10-19 08:17 | 64K | |
![[IMG]](/icons/image2.gif) | romanticlife-300x199.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | 4-585x438.jpg | 2022-10-19 08:17 | 61K | |
![[IMG]](/icons/image2.gif) | 9918_575835219495_5406017_33494805_8109843_n-585x438.jpg | 2022-10-19 08:17 | 54K | |
![[IMG]](/icons/image2.gif) | Chrysler-Museum-of-Art-Credit-Roy-A-Barnes-585-150x150.jpg | 2022-10-19 08:17 | 5.3K | |
![[IMG]](/icons/image2.gif) | dangerous-scorpion.jpg | 2022-10-19 08:17 | 95K | |
![[IMG]](/icons/image2.gif) | isnatnbuleats1-300x200.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | more-pao-de-acucar-150x150.jpg | 2022-10-19 08:17 | 7.8K | |
![[IMG]](/icons/image2.gif) | nyctday-150x150.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | packlightbonddr-300x199.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | vegbaklanva.jpg | 2022-10-19 08:17 | 78K | |
![[IMG]](/icons/image2.gif) | 2-Tavuk-150x150.jpg | 2022-10-19 08:17 | 6.4K | |
![[IMG]](/icons/image2.gif) | 3 - Fuji-150x150.jpg | 2022-10-19 08:17 | 6.3K | |
![[IMG]](/icons/image2.gif) | 5-Supportzc-300x199.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | 17825_zoom1.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | angryellie-300x209.jpg | 2022-10-19 08:17 | 31K | |
![[IMG]](/icons/image2.gif) | costa-rica4 edited-260x350.jpg | 2022-10-19 08:17 | 31K | |
![[IMG]](/icons/image2.gif) | costawab-300x200.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | hotels-collage-3-150x150.jpg | 2022-10-19 08:17 | 8.5K | |
![[IMG]](/icons/image2.gif) | laplandnye-300x199.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | mjuadarraveg-150x150.jpg | 2022-10-19 08:17 | 8.5K | |
![[IMG]](/icons/image2.gif) | photoclasssy-150x150.jpg | 2022-10-19 08:17 | 8.3K | |
![[IMG]](/icons/image2.gif) | 5reindeercold-150x150.jpg | 2022-10-19 08:17 | 9.4K | |
![[IMG]](/icons/image2.gif) | 13703_zoom1-150x150.jpg | 2022-10-19 08:17 | 7.3K | |
![[IMG]](/icons/image2.gif) | 13703_zoom1.jpg | 2022-10-19 08:17 | 74K | |
![[IMG]](/icons/image2.gif) | chilewab-150x150.jpg | 2022-10-19 08:17 | 9.3K | |
![[IMG]](/icons/image2.gif) | costawabrica-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | dangerous-box-jelly-640x426.jpg | 2022-10-19 08:17 | 39K | |
![[IMG]](/icons/image2.gif) | noprivacy.jpg | 2022-10-19 08:17 | 57K | |
![[IMG]](/icons/image2.gif) | southkoreawb.jpg | 2022-10-19 08:17 | 66K | |
![[IMG]](/icons/image2.gif) | tigersafairnye.jpg | 2022-10-19 08:17 | 73K | |
![[IMG]](/icons/image2.gif) | tuekrytday-150x150.jpg | 2022-10-19 08:17 | 7.2K | |
![[IMG]](/icons/image2.gif) | 5-Aletria-300x208.png | 2022-10-19 08:17 | 131K | |
![[IMG]](/icons/image2.gif) | 10-avocado-300x225.jpg | 2022-10-19 08:17 | 9.4K | |
![[IMG]](/icons/image2.gif) | 316Ea4+y0ZL-150x150.jpg | 2022-10-19 08:17 | 3.5K | |
![[IMG]](/icons/image2.gif) | 6327403275_963f60d62b_z-300x225.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | 6327403275_963f60d62b_z.jpg | 2022-10-19 08:17 | 55K | |
![[IMG]](/icons/image2.gif) | DSC_2077.jpg | 2022-10-19 08:17 | 73K | |
![[IMG]](/icons/image2.gif) | Eastbridge-Windpump-at-Museum-of-East-Anglian-Life-199x300.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | Peking-Duck-300x200.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | bunnychowveg-150x150.jpg | 2022-10-19 08:17 | 8.6K | |
![[IMG]](/icons/image2.gif) | lion1011danger-150x150.jpg | 2022-10-19 08:17 | 9.4K | |
![[IMG]](/icons/image2.gif) | tangosy.jpg | 2022-10-19 08:17 | 47K | |
![[IMG]](/icons/image2.gif) | 1-Environmental-Education1-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | 1-Montreal-Champ-de-Mars-Station.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | 11-Kiev-300x225.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | 12-Lisboa.jpg | 2022-10-19 08:17 | 43K | |
![[IMG]](/icons/image2.gif) | 14-Washington-by-Genista-300x199.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | DSC_2132-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | Disney World Thanksgiving photo by milst1 license cc by-150x150.jpg | 2022-10-19 08:17 | 9.8K | |
![[IMG]](/icons/image2.gif) | Disney World Thanksgiving photo by milst1 license cc by-585x438.jpg | 2022-10-19 08:17 | 68K | |
![[IMG]](/icons/image2.gif) | Indian_cobra-585x451.jpg | 2022-10-19 08:17 | 64K | |
![[IMG]](/icons/image2.gif) | Museum-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | SAM_3451.jpg | 2022-10-19 08:17 | 77K | |
![[IMG]](/icons/image2.gif) | isnatnbuleats1-150x150.jpg | 2022-10-19 08:17 | 9.3K | |
![[IMG]](/icons/image2.gif) | noprivacy-262x350.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | vegarepa-300x224.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | 1-Environmental-Education-300x199.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | 6-Animal-Species-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | Domestique in the Tour De France-585x438.jpg | 2022-10-19 08:17 | 62K | |
![[IMG]](/icons/image2.gif) | Indiapic2-150x150.jpg | 2022-10-19 08:17 | 8.3K | |
![[IMG]](/icons/image2.gif) | Phoenix 132-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | Planet-Earth.jpg | 2022-10-19 08:17 | 40K | |
![[IMG]](/icons/image2.gif) | achsy-300x225.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | deadly-hippo-640x427.jpg | 2022-10-19 08:17 | 71K | |
![[IMG]](/icons/image2.gif) | living in the moment in Chile-150x150.jpg | 2022-10-19 08:17 | 5.2K | |
![[IMG]](/icons/image2.gif) | mazatlan5-300x225.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | tigersafairnye-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | 4-bread-and-butter-300x200.jpg | 2022-10-19 08:17 | 22K | |
![[IMG]](/icons/image2.gif) | First Tour de France model-585x438.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | Steak-Dinner-300x201.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | Una-don.jpg | 2022-10-19 08:17 | 61K | |
![[IMG]](/icons/image2.gif) | Watts-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | alternative 7 - Deer at Sangatsu-do Hall, Nara, Japan-383x585.jpg | 2022-10-19 08:17 | 50K | |
![[IMG]](/icons/image2.gif) | chilewab-300x184.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | dangerous-mosquito-640x427.jpg | 2022-10-19 08:17 | 30K | |
![[IMG]](/icons/image2.gif) | deadly-croc-640x427.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | lion1011danger.jpg | 2022-10-19 08:17 | 55K | |
![[IMG]](/icons/image2.gif) | living in the moment in Chile-585x436.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | museum-cable-car-768x512.jpg | 2022-10-19 08:17 | 95K | |
![[IMG]](/icons/image2.gif) | newpeople-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | wall_decorations_paris.jpg | 2022-10-19 08:17 | 68K | |
![[IMG]](/icons/image2.gif) | 06610641791.jpg | 2022-10-19 08:17 | 75K | |
![[IMG]](/icons/image2.gif) | 1-Quebec-City-300x225.jpg | 2022-10-19 08:17 | 27K | |
![[IMG]](/icons/image2.gif) | flying-nok-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | flying-ticket.jpg | 2022-10-19 08:17 | 63K | |
![[IMG]](/icons/image2.gif) | museum-Margaret-Mitchell-150x150.png | 2022-10-19 08:17 | 50K | |
![[IMG]](/icons/image2.gif) | photo(6)-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | romanticlife.jpg | 2022-10-19 08:17 | 44K | |
![[IMG]](/icons/image2.gif) | DSC_2077-150x150.jpg | 2022-10-19 08:17 | 9.9K | |
![[IMG]](/icons/image2.gif) | Grapes.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | Zchi_bw_cr.jpg | 2022-10-19 08:17 | 79K | |
![[IMG]](/icons/image2.gif) | packlightbonddr.jpg | 2022-10-19 08:17 | 44K | |
![[IMG]](/icons/image2.gif) | pyramidsnye-300x225.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | scubasy-150x150.jpg | 2022-10-19 08:17 | 4.7K | |
![[IMG]](/icons/image2.gif) | 4-hotel-des-arts-300x199.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | 8-Tofu-300x225.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | BuranoWindow.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | Watts-300x225.jpg | 2022-10-19 08:17 | 26K | |
![[IMG]](/icons/image2.gif) | museum-Margaret-Mitchell-768x529.png | 2022-10-19 08:17 | 690K | |
![[IMG]](/icons/image2.gif) | tuekrytday.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | 13-North-Korea-300x225.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | 9918_575835049835_5406017_33494772_639353_n-585x390.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | 5191666478_2c5fc0e587-150x150.jpg | 2022-10-19 08:17 | 5.0K | |
![[IMG]](/icons/image2.gif) | 6350417033_604d9d4f33_z-150x150.jpg | 2022-10-19 08:17 | 9.6K | |
![[IMG]](/icons/image2.gif) | Tiger-Leaping-Gorge.jpg | 2022-10-19 08:17 | 84K | |
![[IMG]](/icons/image2.gif) | Venice-150x150.jpg | 2022-10-19 08:17 | 7.7K | |
![[IMG]](/icons/image2.gif) | bunnychowveg-300x200.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | museum-okeefe-150x150.jpg | 2022-10-19 08:17 | 8.5K | |
![[IMG]](/icons/image2.gif) | museums-apothecary-640x427.jpg | 2022-10-19 08:17 | 58K | |
![[IMG]](/icons/image2.gif) | scubasy.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | turkish-food-meze.jpg | 2022-10-19 08:17 | 120K | |
![[IMG]](/icons/image2.gif) | 1-Quebec-City.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | 7-Biodiversity-300x199.jpg | 2022-10-19 08:17 | 35K | |
![[IMG]](/icons/image2.gif) | Fermented-Shark-150x150.jpg | 2022-10-19 08:17 | 6.4K | |
![[IMG]](/icons/image2.gif) | Great-Wall-Simatai.jpg | 2022-10-19 08:17 | 67K | |
![[IMG]](/icons/image2.gif) | Phoenix 077-150x150.jpg | 2022-10-19 08:17 | 6.4K | |
![[IMG]](/icons/image2.gif) | flyinglui4.jpg | 2022-10-19 08:17 | 31K | |
![[IMG]](/icons/image2.gif) | gazpachoveg-150x150.jpg | 2022-10-19 08:17 | 7.3K | |
![[IMG]](/icons/image2.gif) | museum-Margaret-Mitchell.jpg | 2022-10-19 08:17 | 96K | |
![[IMG]](/icons/image2.gif) | 2207345905_0faa9f56d0_z-300x214.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | Packing-Cubes-300x225.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | Sydney-Australia.jpg | 2022-10-19 08:17 | 31K | |
![[IMG]](/icons/image2.gif) | mazatlan1.jpg | 2022-10-19 08:17 | 63K | |
![[IMG]](/icons/image2.gif) | museums-boats.jpg | 2022-10-19 08:17 | 105K | |
![[IMG]](/icons/image2.gif) | okeefsf11.jpg | 2022-10-19 08:17 | 57K | |
![[IMG]](/icons/image2.gif) | planmissiondr-150x150.jpg | 2022-10-19 08:17 | 6.6K | |
![[IMG]](/icons/image2.gif) | saltcrocdanger10-300x225.jpg | 2022-10-19 08:17 | 28K | |
![[IMG]](/icons/image2.gif) | vegbaklanva-150x150.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | 10-avocado.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | Truffle-150x150.jpg | 2022-10-19 08:17 | 7.2K | |
![[IMG]](/icons/image2.gif) | babypack1011.jpg | 2022-10-19 08:17 | 56K | |
![[IMG]](/icons/image2.gif) | firstnye11-300x225.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | mazatlan6-300x225.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | photo(7)-150x150.jpg | 2022-10-19 08:17 | 8.9K | |
![[IMG]](/icons/image2.gif) | 6 - Diving-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | DSC_2132.jpg | 2022-10-19 08:17 | 118K | |
![[IMG]](/icons/image2.gif) | Fattailed_scorpion-585x438.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | caribbeanthnksgiving.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | everythingdirty-300x200.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | khcali2.jpg | 2022-10-19 08:17 | 97K | |
![[IMG]](/icons/image2.gif) | museum-minnetonka.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | sudanwab.jpg | 2022-10-19 08:17 | 51K | |
![[IMG]](/icons/image2.gif) | turkish-food-salgam-150x150.jpg | 2022-10-19 08:17 | 9.8K | |
![[IMG]](/icons/image2.gif) | 2-150x150.jpg | 2022-10-19 08:17 | 8.4K | |
![[IMG]](/icons/image2.gif) | 6-wasabi-ice-cream-225x300.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | 9-Hotel-Le-Monde-Atlantis-Room-1.jpg | 2022-10-19 08:17 | 64K | |
![[IMG]](/icons/image2.gif) | 41Lwr6ZZm7L._SL1116_.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | 20831_zoom1-300x157.jpg | 2022-10-19 08:17 | 8.2K | |
![[IMG]](/icons/image2.gif) | 6312552257_d1618bcb64_z.jpg | 2022-10-19 08:17 | 96K | |
![[IMG]](/icons/image2.gif) | Pomegranates-300x225.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | Shanghai trip Nov24 2010 to Jan 20 2011 118-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | museum-cable-car-150x150.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | smartmuseumchi-150x150.jpg | 2022-10-19 08:17 | 7.8K | |
![[IMG]](/icons/image2.gif) | 7sloveniacold-300x192.jpg | 2022-10-19 08:17 | 15K | |
![[IMG]](/icons/image2.gif) | Mayflower II in Plymouth photo by dicktay2000, license cc-by-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | SAM_3270-300x225.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | dangerous-lion-640x426.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | iPad.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | laplandnye-150x150.jpg | 2022-10-19 08:17 | 9.2K | |
![[IMG]](/icons/image2.gif) | meze-150x150.jpg | 2022-10-19 08:17 | 9.0K | |
![[IMG]](/icons/image2.gif) | 00141-300x178.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 2-Tavuk-300x200.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | 3 - Lagoon and desert amidst the Andes, Bolivia-150x150.jpg | 2022-10-19 08:17 | 6.3K | |
![[IMG]](/icons/image2.gif) | 4-National-Park-300x228.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | 4-National-Park.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | 4-hotel-des-arts-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 5-HotelFoxRoom-106.jpg | 2022-10-19 08:17 | 57K | |
![[IMG]](/icons/image2.gif) | 5191666478_2c5fc0e587-350x262.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | costa-rica5 edited-150x150.jpg | 2022-10-19 08:17 | 9.2K | |
![[IMG]](/icons/image2.gif) | flying-departures-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | museum-civil-rights-150x150.jpg | 2022-10-19 08:17 | 9.2K | |
![[IMG]](/icons/image2.gif) | okeefsf11-150x150.jpg | 2022-10-19 08:17 | 9.1K | |
![[IMG]](/icons/image2.gif) | southkoreawb-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | 8-Spiegelzimmer01-Propeller-Island.jpg | 2022-10-19 08:17 | 73K | |
![[IMG]](/icons/image2.gif) | 14-Washington-by-Genista.jpg | 2022-10-19 08:17 | 35K | |
![[IMG]](/icons/image2.gif) | 9918_575835049835_5406017_33494772_639353_n-150x150.jpg | 2022-10-19 08:17 | 7.4K | |
![[IMG]](/icons/image2.gif) | 30347_zoom1-300x281.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | Blast-Furnaces-at-Blists-Hill.jpg | 2022-10-19 08:17 | 56K | |
![[IMG]](/icons/image2.gif) | Great-Wall-Simatai-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | laplandnye.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | museum-6th-floor-768x512.jpg | 2022-10-19 08:17 | 77K | |
![[IMG]](/icons/image2.gif) | museum-6th-floor.jpg | 2022-10-19 08:17 | 130K | |
![[IMG]](/icons/image2.gif) | museum-cable-car-640x427.jpg | 2022-10-19 08:17 | 70K | |
![[IMG]](/icons/image2.gif) | 5-232x350.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | First Tour de France model-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | Sitting Alone-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | flying-thumb.jpg | 2022-10-19 08:17 | 9.8K | |
![[IMG]](/icons/image2.gif) | museum-6th-floor-640x427.jpg | 2022-10-19 08:17 | 57K | |
![[IMG]](/icons/image2.gif) | shoes, drink and phone-585x435.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | turkish-lahmacun-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | 1-murtabak-200x300.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | 8-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | Dangerous-Animals-1024x558.jpg | 2022-10-19 08:17 | 85K | |
![[IMG]](/icons/image2.gif) | Family.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | SAM_3451-300x228.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | badboysdr.jpg | 2022-10-19 08:17 | 33K | |
![[IMG]](/icons/image2.gif) | dangerous-elephant-150x150.jpg | 2022-10-19 08:17 | 9.1K | |
![[IMG]](/icons/image2.gif) | flyinglui3.jpg | 2022-10-19 08:17 | 52K | |
![[IMG]](/icons/image2.gif) | geogriaiwab.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | museum-taliesin-768x575.jpg | 2022-10-19 08:17 | 54K | |
![[IMG]](/icons/image2.gif) | sudanwab-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | surfingsy-300x200.jpg | 2022-10-19 08:17 | 24K | |
![[IMG]](/icons/image2.gif) | 3-Gladstone-hotel-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 6-wasabi-ice-cream.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | 7-Shanghai-300x225.jpg | 2022-10-19 08:17 | 33K | |
![[IMG]](/icons/image2.gif) | BuranoWindow-150x150.jpg | 2022-10-19 08:17 | 3.3K | |
![[IMG]](/icons/image2.gif) | isteast6-300x199.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | museums-apothecary-768x512.jpg | 2022-10-19 08:17 | 77K | |
![[IMG]](/icons/image2.gif) | smartmuseumchi.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | turkish-hamsi.jpg | 2022-10-19 08:17 | 96K | |
![[IMG]](/icons/image2.gif) | Planet-Earth-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | americas_cup_yacht_sailing_auckland-150x150.jpg | 2022-10-19 08:17 | 8.0K | |
![[IMG]](/icons/image2.gif) | iPad-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | khcali2-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | khcali6-150x150.jpg | 2022-10-19 08:17 | 7.7K | |
![[IMG]](/icons/image2.gif) | museum-mill-city-640x427.jpg | 2022-10-19 08:17 | 53K | |
![[IMG]](/icons/image2.gif) | romancetravel1011-150x150.jpg | 2022-10-19 08:17 | 7.2K | |
![[IMG]](/icons/image2.gif) | turkish-food-meze-640x497.jpg | 2022-10-19 08:17 | 58K | |
![[IMG]](/icons/image2.gif) | 06610641791-300x204.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | 5-Toronto-150x150.jpg | 2022-10-19 08:17 | 7.8K | |
![[IMG]](/icons/image2.gif) | 9 - Wenslas Square, Prague, Czech Republic-585x438.jpg | 2022-10-19 08:17 | 75K | |
![[IMG]](/icons/image2.gif) | 640px-Kokoreç-150x150.jpg | 2022-10-19 08:17 | 9.1K | |
![[IMG]](/icons/image2.gif) | 9918_575835219495_5406017_33494805_8109843_n-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | Celebrating-like-a-local-300x186.jpg | 2022-10-19 08:17 | 22K | |
![[IMG]](/icons/image2.gif) | Elderflower-300x199.jpg | 2022-10-19 08:17 | 13K | |
![[IMG]](/icons/image2.gif) | dodocase-560-blue-4-150x150.jpg | 2022-10-19 08:17 | 8.3K | |
![[IMG]](/icons/image2.gif) | romanticlife-150x150.jpg | 2022-10-19 08:17 | 8.8K | |
![[IMG]](/icons/image2.gif) | tigersafairnye-300x200.jpg | 2022-10-19 08:17 | 17K | |
![[IMG]](/icons/image2.gif) | 7-Sandton_Hotel_De_Filosoof_Red_room2.jpg | 2022-10-19 08:17 | 44K | |
![[IMG]](/icons/image2.gif) | 8-Spiegelzimmer01-Propeller-Island-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | 10-avocado-150x150.jpg | 2022-10-19 08:17 | 4.5K | |
![[IMG]](/icons/image2.gif) | Auckland_city-150x150.jpg | 2022-10-19 08:17 | 8.4K | |
![[IMG]](/icons/image2.gif) | Canal-Basin-at-Black-Country-Living-Museum-150x150.jpg | 2022-10-19 08:17 | 8.7K | |
![[IMG]](/icons/image2.gif) | Higgins-Wharf-Underground-Railroad-Credit-Roy-A-Barnes-585.jpg | 2022-10-19 08:17 | 46K | |
![[IMG]](/icons/image2.gif) | angryhippos10-150x150.jpg | 2022-10-19 08:17 | 9.5K | |
![[IMG]](/icons/image2.gif) | costa-rica2 edited-150x150.jpg | 2022-10-19 08:17 | 12K | |
![[IMG]](/icons/image2.gif) | flyinglui1.jpg | 2022-10-19 08:17 | 31K | |
![[IMG]](/icons/image2.gif) | lion1011danger-300x199.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | museum-minnetonka-150x150.jpg | 2022-10-19 08:17 | 5.0K | |
![[IMG]](/icons/image2.gif) | nyekilisummit-300x225.jpg | 2022-10-19 08:17 | 21K | |
![[IMG]](/icons/image2.gif) | 15-St-Petersburg-300x207.jpg | 2022-10-19 08:17 | 22K | |
![[IMG]](/icons/image2.gif) | 640px-Kokoreç3-300x225.jpg | 2022-10-19 08:17 | 23K | |
![[IMG]](/icons/image2.gif) | Kokoreç-150x150.jpg | 2022-10-19 08:17 | 8.7K | |
![[IMG]](/icons/image2.gif) | Shanghai trip Nov24 2010 to Jan 20 2011 005-150x150.jpg | 2022-10-19 08:17 | 7.5K | |
![[IMG]](/icons/image2.gif) | dangerous-elephant-640x427.jpg | 2022-10-19 08:17 | 49K | |
![[IMG]](/icons/image2.gif) | geogriaiwab-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
![[IMG]](/icons/image2.gif) | meditationsy.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | 1-Montreal-Champ-de-Mars-Station-300x225.jpg | 2022-10-19 08:17 | 29K | |
![[IMG]](/icons/image2.gif) | 5-Toronto-300x199.jpg | 2022-10-19 08:17 | 16K | |
![[IMG]](/icons/image2.gif) | 8-Spiegelzimmer01-Propeller-Island-300x225.jpg | 2022-10-19 08:17 | 30K | |
![[IMG]](/icons/image2.gif) | 5311587371_508ba09c08-150x150.jpg | 2022-10-19 08:17 | 9.5K | |
![[IMG]](/icons/image2.gif) | Polar_bears-150x150.jpg | 2022-10-19 08:17 | 7.3K | |
![[IMG]](/icons/image2.gif) | Turkish-Istanbul-copy-150x150.jpg | 2022-10-19 08:17 | 8.4K | |
![[IMG]](/icons/image2.gif) | Watts.jpg | 2022-10-19 08:17 | 45K | |
![[IMG]](/icons/image2.gif) | flyinglui3-300x200.jpg | 2022-10-19 08:17 | 22K | |
![[IMG]](/icons/image2.gif) | lahmacun-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | mazatlan1-300x225.jpg | 2022-10-19 08:17 | 20K | |
![[IMG]](/icons/image2.gif) | outofshape-262x350.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | 3-Rainforest-Conservation.jpg | 2022-10-19 08:17 | 69K | |
![[IMG]](/icons/image2.gif) | Dana Lookadoo-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | Fermented-Shark1-150x150.jpg | 2022-10-19 08:17 | 7.3K | |
![[IMG]](/icons/image2.gif) | Turkish-cig.jpg | 2022-10-19 08:17 | 58K | |
![[IMG]](/icons/image2.gif) | isteats7.jpg | 2022-10-19 08:17 | 49K | |
![[IMG]](/icons/image2.gif) | museum-smart-640x512.jpg | 2022-10-19 08:17 | 42K | |
![[IMG]](/icons/image2.gif) | 06610641791-150x150.jpg | 2022-10-19 08:17 | 8.1K | |
![[IMG]](/icons/image2.gif) | 3-red-bean-150x150.jpg | 2022-10-19 08:17 | 8.9K | |
![[IMG]](/icons/image2.gif) | 6-Localzc.jpg | 2022-10-19 08:17 | 56K | |
![[IMG]](/icons/image2.gif) | Big-city-300x199.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | Truffle.jpg | 2022-10-19 08:17 | 30K | |
![[IMG]](/icons/image2.gif) | museum-mutter-640x388.jpg | 2022-10-19 08:17 | 18K | |
![[IMG]](/icons/image2.gif) | newpeople-233x350.jpg | 2022-10-19 08:17 | 30K | |
![[IMG]](/icons/image2.gif) | pyramidsnye-150x150.jpg | 2022-10-19 08:17 | 4.7K | |
![[IMG]](/icons/image2.gif) | 0661064179.jpg | 2022-10-19 08:17 | 34K | |
![[IMG]](/icons/image2.gif) | 5 - Chairman Mau directing traffic-150x150.jpg | 2022-10-19 08:17 | 8.6K | |
![[IMG]](/icons/image2.gif) | 6-Frankfurt-300x206.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | 9-Halva-300x225.jpg | 2022-10-19 08:17 | 25K | |
![[IMG]](/icons/image2.gif) | Corkscrew-150x150.jpg | 2022-10-19 08:17 | 9.1K | |
![[IMG]](/icons/image2.gif) | couscouveg-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | istanbuleats3-150x150.jpg | 2022-10-19 08:17 | 10K | |
![[IMG]](/icons/image2.gif) | vegbaklanva-300x225.jpg | 2022-10-19 08:17 | 38K | |
![[IMG]](/icons/image2.gif) | 4-tourzc-300x195.png | 2022-10-19 08:17 | 114K | |
![[IMG]](/icons/image2.gif) | 41Lwr6ZZm7L._SL1116_-300x148.jpg | 2022-10-19 08:17 | 7.0K | |
![[IMG]](/icons/image2.gif) | 51M7DHXP2FL._SS500_.jpg | 2022-10-19 08:17 | 48K | |
![[IMG]](/icons/image2.gif) | Box_jellyfish-150x150.jpg | 2022-10-19 08:17 | 4.8K | |
![[IMG]](/icons/image2.gif) | DSC_2117-300x208.jpg | 2022-10-19 08:17 | 26K | |
![[IMG]](/icons/image2.gif) | Mosquito.jpg | 2022-10-19 08:17 | 55K | |
![[IMG]](/icons/image2.gif) | gblowingsy-300x200.jpg | 2022-10-19 08:17 | 14K | |
![[IMG]](/icons/image2.gif) | mazatlan3.jpg | 2022-10-19 08:17 | 78K | |
![[IMG]](/icons/image2.gif) | museum-Margaret-Mitchell-640x441.jpg | 2022-10-19 08:17 | 36K | |
![[IMG]](/icons/image2.gif) | photoclasssy-300x200.jpg | 2022-10-19 08:17 | 19K | |
![[IMG]](/icons/image2.gif) | turkish-kokorec-640x426.jpg | 2022-10-19 08:17 | 53K | |
![[IMG]](/icons/image2.gif) | turkish-mussels-150x150.jpg | 2022-10-19 08:17 | 11K | |
![[IMG]](/icons/image2.gif) | turkish-thumb-150x150.jpg | 2022-10-19 08:17 | 7.9K | |
|